Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(1S,8S,10S,11R,12S,13S)-4,11,12-trimethoxy-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-triene-3,13-diol
Stephuline · 8β,10β-Epoxy-3,7β,8-trimethoxyhasubanan-4,6β-diol · Hasubanan-4,6-diol, 8,10-epoxy-3,7,8-trimethoxy-, (6β,7β,8β,10β)- (9CI)
![(1S,8S,10S,11R,12S,13S)-4,11,12-trimethoxy-18-oxa-17-azapentacyclo[8.4.3.18,11.01,10.02,7]octadeca-2(7),3,5-triene-3,13-diol 분자 구조식](/img/chemical/178782848.png)
식별자 및 물리적 특성
| CAS No. | 30753-39-0 |
|---|---|
| 분자식 | C19H25NO6 |
| 평균 분자량 | 363.4 g/mol |
| SMILES | COc1ccc2c(c1O)[C@@]13CCN[C@@]14C[C@@H]2O[C@@]4(OC)[C@@H](OC)[C@@H](O)C3 |
| InChIKey | ACRRBZDXZFFIGZ-AMTPKYOQSA-N |
화학 및 물리적 성질
| XLogP | 0 |
|---|---|
| 극성 표면적 | 89.4 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 26 |
| 형식 전하 | 0 |
| 복잡도 | 590 |
| 녹는점 | 223-5°C |
| 끓는 점 | 558.1±50.0 °C(Predicted) |
| 밀도 | 1.41±0.1 g/cm3(Predicted) |
| pKa(산도 계수) | 9.82±0.70(Predicted) |
용도
개요
Isolated from Stephania hernandifolia, this base forms colourless crystals from CHCl3 and has [α]32D + 93° (c 0.55, MeOH). It gives an ultraviolet spectrum in EtOH which exhibits two absorption maxima at 226 and 283 mil. The base contains three methoxyl groups, one phenolic and one non-phenolic hydroxyl group and an imino group. The N-methyl derivative is crystalline with m.p. 125-8°C.