식별자 및 물리적 특성
| CAS No. | 885460-52-6 |
|---|
| 분자식 | C27H48N6O6 |
|---|
| 평균 분자량 | 552.7 g/mol |
|---|
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)NCC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)NC)C(C)C |
|---|
| InChIKey | DPUYCSDGMSDKKV-MKBYFEBXSA-N |
|---|
| ChEBI | CHEBI:177837 |
|---|
| EC No. | 232-701-4 |
|---|
화학 및 물리적 성질
| XLogP | 0.1 |
|---|
| 극성 표면적 | 166 |
|---|
| 수소 결합 공여자 수 | 5 |
|---|
| 수소 결합 수용자 수 | 6 |
|---|
| 회전 가능 결합 수 | 14 |
|---|
| 무거운 원자 수 | 39 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 892 |
|---|
| 물질 분류 | Biological Agents -> Proteins |
|---|
| 화장품 | Cosmetic ingredients (Elastin) -> CIR (Cosmetic Ingredient Review)Skin conditioningSmoothing |
|---|
| Physical Description | Powder[Sigma-Aldrich MSDS] |
|---|
| 끓는 점 | 916.6±65.0 °C(Predicted) |
|---|
| 밀도 | 1.126±0.06 g/cm3(Predicted) |
|---|
| 저장 조건 | 2-8°C |
|---|
| 용해도 | H2O: pH>7에서 >10 mg/mL 더 잘 용해됨 |
|---|
| 물리적 상태 | 동결건조된 분말 |
|---|
| pKa(산도 계수) | 13.38±0.46(Predicted) |
|---|
안전 및 규제
| 규제 정보 | Chemical: ElastinsElastin: Does not have an individual approval but may be used under an appropriate group standard |
|---|
| 기타 안전 정보 | IMAP assessments - Elastins: Environment tier I assessment |
|---|
| 유해성 요약 | May cause irritation[Sigma-Aldrich MSDS] |
|---|
| 독성 요약 | Safe in the present practices of use and concentration. Ingredient, concentration, and use information are available in documents discoverable at https://cir-reports.cir-safety.org |
|---|
| 수질 위해 등급(WGK) | 3 |
|---|
| 위험 표시 | B |
|---|
