Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-아미노-1-페닐피라졸-4-카르복사미드
5-아미노-1-페닐피라졸-4-카르복사미드 · NSC 50566 · NSC 11602 · TIMTEC-BB SBB005883 · 5-AMINO-1-PHENYLPYRAZOLE-4-CARBOXAMIDE · 5-azanyl-1-phenyl-pyrazole-4-carboxamide · 5-amino-1-phenyl-1,4-pyrazolecarboxamide · 5-Amino-1-phenyl-1H-pyrazole-4-carboxamide
식별자 및 물리적 특성
| CAS No. | 50427-77-5 |
|---|---|
| 분자식 | C10H10N4O |
| 평균 분자량 | 202.21 g/mol |
| 단동위원소 질량 | 202.08546094 g/mol |
| SMILES | NC(=O)c1cnn(-c2ccccc2)c1N |
| InChIKey | UBKSUPKIDNXMMC-UHFFFAOYSA-N |
| PubChem CID | 1802 |
| ChEMBL | CHEMBL4544218 |
| EC No. | 637-132-9 |
| DTXSID | DTXSID90274334 |
| 현지명 | 5-아미노-1-페닐피라졸-4-카르복사미드 |
화학 및 물리적 성질
| XLogP | 1 |
|---|---|
| 극성 표면적 | 86.9 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 240 |
| 녹는점 | 169-172 |
| 끓는 점 | 423.7±25.0 °C(Predicted) |
| 밀도 | 1.41±0.1 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | DMSO및메탄올에 용해됨 |
| pKa(산도 계수) | 15.05±0.50(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 회백색 |
| InChI | InChI=1S/C10H10N4O/c11-9-8(10(12)15)6-13-14(9)7-4-2-1-3-5-7/h1-6H,11H2,(H2,12,15) |
| InChIKey | UBKSUPKIDNXMMC-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2)C(N)=C(C(N)=O)C=N1 |
| NIST | 5-Amino-1-phenylpyrazole-4-carboxamide(50427-77-5) |
화학적 성질
Off-White Solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2933199090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | IRRITANT |
용도
용도
5-AMino-1-phenylpyrazole-4-carboxamide is used as a heterocyclic scaffold.