Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
알파,알파,알파',알파'-테트라메틸-1,4-벤젠디메탄올
알파,알파,알파',알파'-테트라메틸-1,4-벤젠디메탄올 · 1,4-비스(1-메틸-1-히드록시에틸)벤젠 · 1,4-bis(2-hydroxy-2-propyl)benzene · Dicumyl alcohol · TIMTEC-BB SBB007806 · 1,4-Bis(2-propanol)benzene · 2,2'-(P-PHENYLENE)DI-2-PROPANOL · p-bis(2-hydroxyisopropyl)benzene
식별자 및 물리적 특성
| CAS No. | 2948-46-1 |
|---|---|
| 분자식 | C12H18O2 |
| 평균 분자량 | 194.27 g/mol |
| 단동위원소 질량 | 194.13067982 g/mol |
| SMILES | CC(C)(O)c1ccc(C(C)(C)O)cc1 |
| InChIKey | LEARFTRDZQQTDN-UHFFFAOYSA-N |
| PubChem CID | 18062 |
| ChEMBL | CHEMBL3187761 |
| EC No. | 220-964-8 |
| DTXSID | DTXSID7029247 |
| 현지명 | 알파,알파,알파',알파'-테트라메틸-1,4-벤젠디메탄올 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 40.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 166 |
| 물질 분류 | Industrial compound |
| Polymers | Other Classes -> Alcohols and Polyols, Other |
| SpringerMaterials Properties | Boiling point |
| Physical Description | Solid[MSDSonline] |
| 녹는점 | 144-146 °C (lit.) |
| 끓는 점 | 167-168 °C/12 mmHg (lit.) |
| 밀도 | 1.0010 (rough estimate) |
| 굴절률 | 1.5050 (estimate) |
| 인화점 | 167-168°C/12mm |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 14.25±0.29(Predicted) |
| 색상 | 흰색에서 밝은 노란색 |
| 용해도 | 물에 약간 용해됨(2.1g/L)(25°C). |
| InChI | InChI=1S/C12H18O2/c1-11(2,13)9-5-7-10(8-6-9)12(3,4)14/h5-8,13-14H,1-4H3 |
| InChIKey | LEARFTRDZQQTDN-UHFFFAOYSA-N |
| SMILES | C(O)(C)(C)C1C=CC(C(O)(C)C)=CC=1 |
| EPA | 1,4-Bis(2-hydroxy-2-propyl)benzene (2948-46-1) |
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 2.3% (1 of 44) of reports.WarningH315 (97.7%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | An irritant[MSDSonline] |
| Hazard Classes and Categories | Skin Irrit. 2 (97.7%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 2906290090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39-36 |
| 기존화학 물질 | KE-33557 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 2948-46-1(Hazardous Substances Data) |
용도
용도
1,4-Bis(2-hydroxyisopropyl)benzene is used as a pharmaceutical intermediate.