나이트로푸라존
니트로푸라존 · 나이트로푸라존 · 나이트로퓨라존 · NFS · NF · semicarbazone · FURACILIN · NITROFURAL
식별자 및 물리적 특성
| CAS No. | 59-87-0 |
|---|---|
| 분자식 | C6H6N4O4 |
| 평균 분자량 | 198.14 g/mol |
| 단동위원소 질량 | 198.03890469 g/mol |
| SMILES | NC(=O)NN=Cc1ccc([N+](=O)[O-])o1 |
| InChIKey | IAIWVQXQOWNYOU-UHFFFAOYSA-N |
| PubChem CID | 1839 |
| ChEMBL | CHEMBL1603968 |
| DTXSID | DTXSID5020944 |
| 현지명 | 나이트로푸라존 |
화학 및 물리적 성질
| XLogP | 0.2 |
|---|---|
| 극성 표면적 | 126 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 261 |
| SpringerMaterials Properties | Crystal structure |
| LogP(분배 계수) | 0.74 |
| Animal Drugs | Pharmaceuticals -> Animal Drugs -> Approved in Taiwan |
| 녹는점 | 242-244 °C (lit.) |
| 끓는 점 | 335.43°C (rough estimate) |
| 밀도 | 1.6031 (rough estimate) |
| 굴절률 | 1.6500 (estimate) |
| 인화점 | 2 °C |
| 저장 조건 | 2-8°C |
| 용해도 | 물에는 매우 약간 용해되고, 에탄올에는 약간 용해됩니다(96%). |
| pKa(산도 계수) | pKa 9.28± 0.03( EtOH,t =35±0.1,I=0.00) (Uncertain) |
| 물리적 상태 | Solid |
| 색상 | 노란색에서 진한 노란색까지 |
| 용해도 | 19ºC에서 <0.1g/100mL |
| Merck | 14,6600 |
| BRN | 86403 |
| 주요 응용 | 의약품(소분자) |
| 화장품 원료 기능 | 항균 |
| InChI | 1S/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+ |
| InChIKey | IAIWVQXQOWNYOU-FPYGCLRLSA-N |
| SMILES | NC(=O)N\N=C\c1ccc(o1)[N+]([O-])=O |
| NIST | 5-Nitro furfural semicarbazone(59-87-0) |
| EPA | Nitrofurazone (59-87-0) |
화학적 성질
white to light yellow crystal powde
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | LT7700000 |
| 운송 번호(UN) | 3249 |
| 독성 | LD50 in rats (g/kg): 0.59 orally3.0 s.c. (Godwin) |
| 관세 코드 | 29321900 |
| 위험 문구(R) | 22-36-20/21/22-11 |
| 위험 표시 | Xn,F |
| 안전 문구(S) | 36-36/37-26-16 |
| 포장분류 | III |
| 위험 등급 | 6.1(b)Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Flam. Liq. 2 |
| F 고인화성물질 | 8 |
| 저장 분류 | 3 - Flammable liquids |
| 유해 물질 데이터 | 59-87-0(Hazardous Substances Data) |
용도
개요
Nitrofurazone is an antibacterial agent used in animal feed. Occupational dermatitis was reported in cattle breeders and farmers.
용도
Nitrofurazone is a topical anti-infective and bactericide for most pathogens commonly causing surface infections; in the adjunctive therapy of patients with second and third degree bums when bacterial resistance to other agents is areal or potential problem; in skin grafting where bacterial contamination may cause graft rejection and/or donor-site infection; antibacterial agent for the treatment or prevention of infections in a variety of conditions involving skin, eyes, ears, nose and genito-urinary tract; used on pyodermas, ulcers, and wounds; affects some protozoa and is an effective prophylaxis against nosocomial infections; antiseptic lubricant for trans urethral resection; anti-microbial in veterinary medicine.
일반 설명
Odorless pale yellow needles or yellow powder. pH (saturated aqueous solution) 6.0 - 6.5. Alkaline solutions are dark orange.