Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,5-Dichloro-4-hydroxybenzoic acid
,5-Dichloro-4-hydroxybenzoic acid · 2-(benzo[d]thiazol-3(2H)-yl)-1-(3,5-dichloro-4-methoxyphenyl)ethanone · AKOS BBS-00006921 · RARECHEM AL BE 0933 · Dotinurad Impurity 34 · Dotinurad Impurity 24 · LABOTEST-BB LT00454970 · Tetrahydrozoline Impurity 4
식별자 및 물리적 특성
| CAS No. | 3336-41-2 |
|---|---|
| 분자식 | C7H4Cl2O3 |
| 평균 분자량 | 207.01 g/mol |
| 단동위원소 질량 | 205.95374935 g/mol |
| SMILES | O=C(O)c1cc(Cl)c(O)c(Cl)c1 |
| InChIKey | AULKDLUOQCUNOK-UHFFFAOYSA-N |
| PubChem CID | 18749 |
| ChEMBL | CHEMBL5630928 |
| ChEBI | CHEBI:53685 |
| EC No. | 222-071-9 |
| DTXSID | DTXSID60186975 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 57.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 173 |
| 농약 | Environmental transformation -> Pesticide transformation products (metabolite, successor) |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 264-266 °C (lit.) |
| 끓는 점 | 297.29°C (rough estimate) |
| 밀도 | 1.5281 (rough estimate) |
| 굴절률 | 1.4845 (estimate) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 3.83±0.10(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| BRN | 2616297 |
| InChI | InChI=1S/C7H4Cl2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| InChIKey | AULKDLUOQCUNOK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=C(O)C(Cl)=C1 |
| NIST | 3,5-Dichloro-4-hydroxybenzoic acid(3336-41-2) |
화학적 성질
White to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Commission Regulation No 844/2012 |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | DG7502000 |
| 관세 코드 | 29182900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3,5-Dichloro-4-hydroxybenzoic Acid can be used as cyclin dependent kinase inhibitors to treat cell proliferative disorders, such as, cancer.