Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4,4'-디클로로벤질
4,4'-디클로로벤질 · p,p'-Dichlorobenzil · 4,4'-Dichlorobenzil · 4,4'-Dichlorobibenzoyl · 4,4'-Dichlorobenzil>4,4'-Dichlorodibenzoyl · Di(4-chlorophenyl) diketone · Bis(4-chlorophenyl) diketone · Bis(p-chlorophenyl)ethanedione
식별자 및 물리적 특성
| CAS No. | 3457-46-3 |
|---|---|
| 분자식 | C14H8Cl2O2 |
| 평균 분자량 | 279.1 g/mol |
| 단동위원소 질량 | 277.99013486 g/mol |
| SMILES | O=C(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChIKey | XMAWUPHYEABFDR-UHFFFAOYSA-N |
| PubChem CID | 18946 |
| ChEMBL | CHEMBL192139 |
| EC No. | 222-387-7 |
| DTXSID | DTXSID4063038 |
| 현지명 | 4,4'-디클로로벤질 |
화학 및 물리적 성질
| XLogP | 4.6 |
|---|---|
| 극성 표면적 | 34.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 282 |
| 녹는점 | 194-197°C |
| 끓는 점 | 220°C/3mmHg(lit.) |
| 밀도 | 1.366±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | powder to crystal |
| 색상 | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C14H8Cl2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H |
| InChIKey | XMAWUPHYEABFDR-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1)(=O)C(C1=CC=C(Cl)C=C1)=O |
| NIST | P-p'-dichloro-benzil(3457-46-3) |
| EPA | 4,4'-Dichlorobenzil (3457-46-3) |
화학적 성질
White Crystal
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 2917.39.7000 |
| 위험 표시 | Xn |