Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
RS 39604 hydrochloride
RS 39604 · RS39604HCl · RS 39604 HYDROCHLORIDE · 1-(4-Amino-5-Chloro-2-(3,5-Dimethoxyphenyl)Methyloxy)-3-(1-(2-Methylsulfonylamino)Ethyl)Piperidin-4- · 1-(4-Amino-5-chloro-2-(3,5-dimethoxyphenyl)methyloxy)-3-(1-(2-methylsulfonylamino)ethyl)piperidin-4-yl)propan-1-onehyd · 1-[4-Amino-5-chloro-2-(3,5-dimethoxyphenyl)methyloxy]-3-[[1-[2-methylsulphonylamino]ethyl]piperidin-4-yl]propan-1-one hydrochloride
식별자 및 물리적 특성
| CAS No. | 167710-87-4 |
|---|---|
| 분자식 | C26H37Cl2N3O6S |
| 평균 분자량 | 590.6 g/mol |
| 단동위원소 질량 | 589.1780125 g/mol |
| SMILES | COc1cc(COc2cc(N)c(Cl)cc2C(=O)CCC2CCN(CCNS(C)(=O)=O)CC2)cc(OC)c1.Cl |
| InChIKey | QSMYZGMJSGUWPM-UHFFFAOYSA-N |
| PubChem CID | 19081934 |
| ChEMBL | CHEMBL586946 |
| ChEBI | CHEBI:64081 |
| DTXSID | DTXSID5042619 |
화학 및 물리적 성질
| 극성 표면적 | 129 |
|---|---|
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 9 |
| 회전 가능 결합 수 | 13 |
| 무거운 원자 수 | 38 |
| 형식 전하 | 0 |
| 복잡도 | 793 |
| 저장 조건 | Store at RT |
| 용해도 | Soluble to 100 mM in DMSO |
| 물리적 상태 | 가루 |
| 색상 | White to off-white |
용도
용도
RS 39604 Hydrochloride is a potent, selective and orally active 5-HT4 receptor antagonist.