식별자 및 물리적 특성
| CAS No. | 148550-19-0 |
|---|
| 분자식 | C10H17N3O2 |
|---|
| 평균 분자량 | 211.26 g/mol |
|---|
| 단동위원소 질량 | 211.13207679 g/mol |
|---|
| SMILES | CCCCc1nc(N)c(C(=O)OCC)[nH]1 |
|---|
| InChIKey | RNJYAWJXRCVBGF-UHFFFAOYSA-N |
|---|
| PubChem CID | 19106923 |
|---|
| EC No. | 186-378-9 |
|---|
화학 및 물리적 성질
| XLogP | 2.5 |
|---|
| 극성 표면적 | 81 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 6 |
|---|
| 무거운 원자 수 | 15 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 211 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
