Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Bis(benzyloxy)(diisopropylamino)phosphine
DIBENZYL N,N-DIISOPROPYLPHOSPHORAMIDITE · DIBENZYL N,N-DIISOPRO · Dibenzyl-N,N-disisopropylphosphoramidite · LABOTEST-BB LT00451623 · 108549-23-1,108549-23-1 · DIBENZYL DIISOPROPYLPHOSPHORAMIDITE · Dibenzyl diisopropylphosphoramidoite · Dibenyl NN diisopropylphosphoramidite
식별자 및 물리적 특성
| CAS No. | 108549-23-1 |
|---|---|
| 분자식 | C20H28NO2P |
| 평균 분자량 | 345.4 g/mol |
| 단동위원소 질량 | 345.18576577 g/mol |
| SMILES | CC(C)N(C(C)C)P(OCc1ccccc1)OCc1ccccc1 |
| InChIKey | ANPWLBTUUNFQIO-UHFFFAOYSA-N |
| PubChem CID | 196621 |
| EC No. | 629-628-9 |
| DTXSID | DTXSID70148584 |
화학 및 물리적 성질
| XLogP | 4.8 |
|---|---|
| 극성 표면적 | 21.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 9 |
| 무거운 원자 수 | 24 |
| 형식 전하 | 0 |
| 복잡도 | 296 |
| 끓는 점 | 130 °C0.55 mm Hg(lit.) |
| 밀도 | 1.028 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.535(lit.) |
| 인화점 | 158 °F |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름에 용해됩니다. |
| pKa(산도 계수) | 4.50±0.70(Predicted) |
| 물리적 상태 | 기름 |
| 색상 | 투명 무색 |
| 용해도 | THF: soluble(lit.)acetonitrile: soluble(lit.)cold water: insoluble(lit.)dichloromethane: soluble(lit.) |
| BRN | 3616864 |
| InChI | InChI=1S/C20H28NO2P/c1-17(2)21(18(3)4)24(22-15-19-11-7-5-8-12-19)23-16-20-13-9-6-10-14-20/h5-14,17-18H,15-16H2,1-4H3 |
| InChIKey | ANPWLBTUUNFQIO-UHFFFAOYSA-N |
| SMILES | P(N(C(C)C)C(C)C)(OCC1=CC=CC=C1)OCC1=CC=CC=C1 |
화학적 성질
Clear Colourless Liquid
안전 및 규제
| GHS 분류 | WarningH315 (98%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (98%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| F 고인화성물질 | 3-10-21 |
| 저장 분류 | 10 - Combustible liquids |
용도
개요
Dibenzyl diisopropylphosphoramidite is a versatile phosphitylating agent.
용도
A versatile phosphitylating agent