식별자 및 물리적 특성
| CAS No. | 13813-62-2 |
|---|
| 분자식 | H6O13P4 |
|---|
| 평균 분자량 | 337.94 g/mol |
|---|
| 단동위원소 질량 | 337.87588823 g/mol |
|---|
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
|---|
| InChIKey | YDHWWBZFRZWVHO-UHFFFAOYSA-N |
|---|
| PubChem CID | 197147 |
|---|
| EC No. | 237-476-6 |
|---|
| DTXSID | DTXSID60953189 |
|---|
화학 및 물리적 성질
| XLogP | -5.4 |
|---|
| 극성 표면적 | 217 |
|---|
| 수소 결합 공여자 수 | 6 |
|---|
| 수소 결합 수용자 수 | 13 |
|---|
| 회전 가능 결합 수 | 6 |
|---|
| 무거운 원자 수 | 17 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 402 |
|---|
안전 및 규제
| GHS 분류 | DangerH314: Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P271, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P405, and P501 (click each P-code to see the statement) |
|---|
| 규제 정보 | Chemical: Tetraphosphoric acidTetrapolyphosphoric acid: Does not have an individual approval but may be used under an appropriate group standard |
|---|
| 기타 안전 정보 | IMAP assessments - Polyphosphoric acids: Human health tier II assessment |
|---|
| Hazard Classes and Categories | Acute toxicity - category 4 |
|---|
