Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-ADAMANTYL브로모메틸케톤
1-ADAMANTYL브로모메틸케톤 · AKOS BC-0476 · AKOS BBS-00006527 · IFLAB-BB F1928-0001 · OTAVA-BB BB7020410089 · LABOTEST-BB LT00077095 · 1-(BROMOACETYL)ADAMANTANE · Bromomethyl adamantly ketone
식별자 및 물리적 특성
| CAS No. | 5122-82-7 |
|---|---|
| 분자식 | C12H17BrO |
| 평균 분자량 | 257.17 g/mol |
| 단동위원소 질량 | 256.04627726 g/mol |
| SMILES | O=C(CBr)C12CC3CC(CC(C3)C1)C2 |
| InChIKey | KWCDIRFSULAMOC-UHFFFAOYSA-N |
| PubChem CID | 197820 |
| EC No. | 225-860-6 |
| DTXSID | DTXSID80199229 |
| 현지명 | 1-ADAMANTYL브로모메틸케톤 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 230 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 76-79 °C (lit.) |
| 끓는 점 | 320.3±15.0 °C(Predicted) |
| 밀도 | 1.439±0.06 g/cm3(Predicted) |
| 저장 조건 | Storage temp. 2-8°C |
| 물리적 상태 | solid |
| InChI | 1S/C12H17BrO/c13-7-11(14)12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2/t8-,9+,10-,12- |
| InChIKey | KWCDIRFSULAMOC-GOCCLTDMSA-N |
| SMILES | BrCC(=O)C12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
화학적 성질
White crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (97.6%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (97.6%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29142900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39-36/37/39-27 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
1-Adamantyl bromomethyl ketone may be used in chemical synthesis studies.