Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,4-디히드록시-α-아미노아세토페논염산염
3,4-디히드록시-α-아미노아세토페논염산염 · Noradrenalone Hydrochloride · 2-amino-1-(3,4-dihydroxyphenyl)ethan-1-one hydrochloride · Noradrenalone HCl · NORADRENALINE IMPURITY B · Norepinephrine Impurity 1 · Carbazochrome Impurity 23 · NORADRENALONE HYDROCHLORIDYL
식별자 및 물리적 특성
| CAS No. | 5090-29-9 |
|---|---|
| 분자식 | C8H10ClNO3 |
| 평균 분자량 | 203.62 g/mol |
| 단동위원소 질량 | 203.03492086 g/mol |
| SMILES | Cl.NCC(=O)c1ccc(O)c(O)c1 |
| InChIKey | ILTXTELYZNIJHL-UHFFFAOYSA-N |
| PubChem CID | 199831 |
| DTXSID | DTXSID30198929 |
| 현지명 | 3,4-디히드록시-α-아미노아세토페논염산염 |
화학 및 물리적 성질
| 극성 표면적 | 83.6 |
|---|---|
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 172 |
| 녹는점 | 255 °C |
| 저장 조건 | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| 용해도 | DMSO(약간 용해됨, 가열), 물(매우 약간, 가열) |
| 물리적 상태 | 고체 |
| 색상 | 진한 노란색에서 진한 갈색까지 |
| InChI | InChI=1S/C8H9NO3.ClH/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,10-11H,4,9H2 |
| InChIKey | ILTXTELYZNIJHL-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(O)C(O)=C1)CN.[H]Cl |
용도
용도
Noradrenalone Hydrochloride is an intermediate of Norepinephrine (N674500), an antagonist of dibutyryl cyclic AMP in the regulation of narcosis. Norepinephrine modulates human dendritic cell activation by altering cytokine release.
제조 및 합성 방법
제조 방법
Preparation by demethylation of a-amino-3,4-dimethoxy-acetophenone on heating with 37% hydrochloric acid for 2.5 h at 160–165° under carbon dioxide (85%).