Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-methyliminodiacetic acid
MIDA · METHYLIMINODIACETIC ACID · 2,2'-(methylazanediyl)diacetic acid · strombine · MIDA ligand · N-Methyliminodiaceticaci · Methyliminobisacetic acid · N-METHYLIMINODIACETIC ACID
식별자 및 물리적 특성
| CAS No. | 4408-64-4 |
|---|---|
| 분자식 | C5H9NO4 |
| 평균 분자량 | 147.13 g/mol |
| 단동위원소 질량 | 147.05315777 g/mol |
| SMILES | CN(CC(=O)O)CC(=O)O |
| InChIKey | XWSGEVNYFYKXCP-UHFFFAOYSA-N |
| PubChem CID | 20441 |
| ChEMBL | CHEMBL1741474 |
| EC No. | 224-557-6 |
| DTXSID | DTXSID00196033 |
화학 및 물리적 성질
| XLogP | -3.3 |
|---|---|
| 극성 표면적 | 77.8 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 129 |
| 녹는점 | 220 °C (dec.)(lit.) |
| 끓는 점 | 267.21°C (rough estimate) |
| 밀도 | 1.4285 (rough estimate) |
| 굴절률 | 1.4210 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 메탄올(약간 가열, 초음파 처리), 물 에 용해됨 |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | pK1:2.15pK2:10.09 (25°C) |
| 색상 | 흰색에서 크림색으로 |
| 용해도 | 물에 용해됩니다. 디메틸설폭사이드에 약간 용해됩니다. |
| BRN | 1765449 |
| InChI | InChI=1S/C5H9NO4/c1-6(2-4(7)8)3-5(9)10/h2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | XWSGEVNYFYKXCP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(CC(O)=O)C |
| LogP(분배 계수) | -0.910 (est) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Glycine, N-(carboxymethyl)-N-methyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | No |
| 관세 코드 | 29171900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39-24/25 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
N-Methyliminodiacetic acid is used to prepare bis-(1H-benzoimidazol-2-ylmethyl)-methyl-amine by condensation with benzene-1,2-diamine. It is involved in Suzuki cross-coupling with N-methyliminodiacetic acid (MIDA) boronates. It acts as a reagent utilized for protecting boronic acids and as a chelating agent for various metals.