Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
6,6'-Bi-2-picoline
6,6'-Dimethyl-2,2'-bipyridine · Bipicoline · 2-methyl-6-(6-methylpyridin-2-yl)pyridine · 6,6’-dimethyl-2’-bipyridine · AKOS BBS-00000187 · 6,6'-DI-2-PICOLYL · 6,6'-Bi-2-picoline · 6,6''-BI-2-PICOLINE 98+%
식별자 및 물리적 특성
| CAS No. | 4411-80-7 |
|---|---|
| 분자식 | C12H12N2 |
| 평균 분자량 | 184.24 g/mol |
| 단동위원소 질량 | 184.10004838 g/mol |
| SMILES | Cc1cccc(-c2cccc(C)n2)n1 |
| InChIKey | OHJPGUSXUGHOGE-UHFFFAOYSA-N |
| PubChem CID | 20445 |
| ChEMBL | CHEMBL2205806 |
| EC No. | 224-566-5 |
| DTXSID | DTXSID30196041 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 25.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 161 |
| 녹는점 | 93-95 °C(lit.) |
| 끓는 점 | 286 °C |
| 밀도 | 1.060±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | almost transparency in Methanol |
| 물리적 상태 | powder to crystaline |
| pKa(산도 계수) | 5.20±0.22(Predicted) |
| 색상 | 흰색에서 밝은 노란색 |
| InChI | InChI=1S/C12H12N2/c1-9-5-3-7-11(13-9)12-8-4-6-10(2)14-12/h3-8H,1-2H3 |
| InChIKey | OHJPGUSXUGHOGE-UHFFFAOYSA-N |
| SMILES | C1(C2=NC(C)=CC=C2)=NC(C)=CC=C1 |
화학적 성질
White to light brown crystal or powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | DW1767000 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
6,6′-dimethyl-2,2′-bipyridyl (6,6′-Dimethyl-2,2′-bipyridine)may be used in the synthesis of novel oligobipyridine ligands.
일반 설명
6,6′-dimethyl-2,2′-bipyridyl (dmbp) also known as 6,6′-dimethyl-2,2′-bipyridine, is commonly used as a ligand to form complexes with ions such as Pd(II), Pt(II), Cu(II), Co(II) and Zn(II). The crystalline structure of dmbp has been investigated. Its synthesis from 6-bromopicoline has been reported.