식별자 및 물리적 특성
| CAS No. | 144671-97-6 |
|---|
| 분자식 | C27H32N4O2 |
|---|
| 평균 분자량 | 444.6 g/mol |
|---|
| SMILES | O.O=c1[nH]c2ccccc2n1CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChIKey | WUVRHFANMRXNRX-UHFFFAOYSA-N |
|---|
| PubChem CID | 20506331 |
|---|
| EC No. | 689-147-5 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 39.8 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 7 |
|---|
| 무거운 원자 수 | 33 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 574 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
