Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Chloro-2-nitrobenzoic acid
3-chloro-2-nitrobenzoate · 2-NITRO-3-CHLOROBENZOICACID · 3-CHOLORO-2-NITROBNZOIC ACID · 3-chloro-2-nitrobenzoicacidt · 3-CHLORO-2-NITROBENZOIC ACID · Benzoic acid, 3-chloro-2-nitro- · 3-Chloro-2-nitrobenzoic Acid >3-CHLORO-2-NITROBENZOIC ACID 99% · 3-Chloro-2-nitrobenzoic acid,98%
식별자 및 물리적 특성
| CAS No. | 4771-47-5 |
|---|---|
| 분자식 | C7H4ClNO4 |
| 평균 분자량 | 201.56 g/mol |
| 단동위원소 질량 | 200.98288529 g/mol |
| SMILES | O=C(O)c1cccc(Cl)c1[N+](=O)[O-] |
| InChIKey | VCHSXYHBMFKRBK-UHFFFAOYSA-N |
| PubChem CID | 20902 |
| EC No. | 225-313-1 |
| DTXSID | DTXSID70197259 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 83.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 227 |
| 녹는점 | 237-239 °C (lit.) |
| 끓는 점 | 365.6±27.0 °C(Predicted) |
| 밀도 | 1.5660 |
| 굴절률 | 1.6000 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 1.82±0.10(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| 용해도 | 0.47g/L(25℃) |
| BRN | 2109828 |
| InChI | InChI=1S/C7H4ClNO4/c8-5-3-1-2-4(7(10)11)6(5)9(12)13/h1-3H,(H,10,11) |
| InChIKey | VCHSXYHBMFKRBK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1[N+]([O-])=O |
화학적 성질
almost white to beige crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29163990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39-24/25-36 |
| 위험 등급 | IRRITANT-HARMFULEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3-Chloro-2-nitrobenzoic acid has been used in the preparation of:2-amino-3-chlorobenzonitrile3-chloro-2-nitrobenzaldehyde
일반 설명
Hydrogen-bonded structures of isomeric compounds of 3-chloro-2-nitrobenzoic acid with quinoline have been investigated.