식별자 및 물리적 특성
| CAS No. | 28166-41-8 |
|---|
| 분자식 | C10H7NO3 |
|---|
| 평균 분자량 | 189.17 g/mol |
|---|
| 단동위원소 질량 | 189.04259308 g/mol |
|---|
| SMILES | N#CC(=Cc1ccc(O)cc1)C(=O)O |
|---|
| InChIKey | AFVLVVWMAFSXCK-UHFFFAOYSA-N |
|---|
| PubChem CID | 2102 |
|---|
| ChEMBL | CHEMBL76602 |
|---|
| EC No. | 248-879-1 |
|---|
| DTXSID | DTXSID501018295 |
|---|
화학 및 물리적 성질
| XLogP | 1.4 |
|---|
| 극성 표면적 | 81.3 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 14 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 292 |
|---|
| 물질 분류 | Other Uses -> Biochemical Research |
|---|
| Physical Description | Powder[Sigma-Aldrich MSDS] |
|---|
안전 및 규제
| GHS 분류 | WarningH315 (98.8%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 165 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| 유해성 요약 | A skin and strong eye irritant[Sigma-Aldrich MSDS] |
|---|
| Hazard Classes and Categories | Skin Irrit. 2 (98.8%) |
|---|
