알프라졸람
알프라졸람 · Xanax · Zolam · 8-CHLORO-1-METHYL-6-PHENYL-4H-[1,2,4]TRIAZOLO[4,3-A][1,4]BENZODIAZEPINE · Trankimazin · 8-Chloro-1-methyl-6-phenyl-4H-2,3,5,10b-tetraazabenzo[e]azulene · d65mt · Tafil
식별자 및 물리적 특성
| CAS No. | 28981-97-7 |
|---|---|
| 분자식 | C17H13ClN4 |
| 평균 분자량 | 308.8 g/mol |
| 단동위원소 질량 | 308.0828741 g/mol |
| SMILES | Cc1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1)=NC2 |
| InChIKey | VREFGVBLTWBCJP-UHFFFAOYSA-N |
| PubChem CID | 2118 |
| ChEMBL | CHEMBL661 |
| ChEBI | CHEBI:2611 |
| EC No. | 249-349-2 |
| DTXSID | DTXSID4022577 |
| 현지명 | 알프라졸람 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 43.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 434 |
| 녹는점 | 228-228.50C |
| 끓는 점 | 463.51°C (rough estimate) |
| 밀도 | 1.2000 (rough estimate) |
| 굴절률 | 1.6110 (estimate) |
| 인화점 | 11 °C |
| 저장 조건 | 2-8°C |
| 용해도 | H2O: 불용성 |
| pKa(산도 계수) | 2.37±0.40(Predicted) |
| 용해도 | 70mg/L(주위온도) |
| BCS Class | 1 |
| 주요 응용 | 의약품(소분자) |
| InChI | 1S/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3 |
| InChIKey | VREFGVBLTWBCJP-UHFFFAOYSA-N |
| SMILES | Cc1nnc2CN=C(c3ccccc3)c4cc(Cl)ccc4-n12 |
| NIST | Alprazolam(28981-97-7) |
| EPA | Alprazolam (28981-97-7) |
화학적 성질
White Crystalline Solid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | XZ5473000 |
| 운송 번호(UN) | 3249 |
| 독성 | LD50 in mice, rats (mg/kg): 1020, >2000 orally540, 610 i.p. (Nakajima) |
| 관세 코드 | 2933910000 |
| 위험 문구(R) | 22-39/23/24/25-23/24/25-11 |
| 위험 표시 | Xn,T,F |
| 안전 문구(S) | 36-45-36/37-16-7 |
| 포장분류 | III |
| 위험 등급 | 6.1(b)Acute Tox. 4 Oral |
| 기존화학 물질 | KE-05770 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 28981-97-7(Hazardous Substances Data) |
| DEA Controlled Substances | CSCN: 2882CAS SCH: ⅣNARC: N |
용도
개요
Alprazolam (Item No. 14255) is an analytical reference material categorized as a benzodiazepine. Alprazolam is regulated as a Schedule IV compound in the United States. This product is intended for research and forensic applications.
용도
Controlled substance (depressant). Anxiolytic
일반 설명
Alprazolam, 8-chloro-1-methyl-6-phenyl-4H-s-triazolo[4,3-a][1,4]benzodiazepine (Xanax), israpidly absorbed from the GI tract. Protein binding is lower(～70%) than with most benzodiazepines because of itslower lipophilicity.α-Hydroxylation of the methyl group tothe methyl alcohol (a reaction analogous to benzylic hydroxylation)followed by conjugation is rapid; consequently,the duration of action is short. The drug is a highlypotent anxiolytic on a milligram basis.