아만타딘
아만타딘 · 1-ADAMANTYLAMINE · Adamantylamine · 1-ADAMANTANAMINE · adamantan-1-amine · (3s,5s,7s)-adaMantan-1-aMine · Adamantamine · ADAMANTANAMINE
식별자 및 물리적 특성
| CAS No. | 768-94-5 |
|---|---|
| 분자식 | C10H17N |
| 평균 분자량 | 151.25 g/mol |
| 단동위원소 질량 | 151.13609955 g/mol |
| SMILES | NC12CC3CC(CC(C3)C1)C2 |
| InChIKey | DKNWSYNQZKUICI-UHFFFAOYSA-N |
| PubChem CID | 2130 |
| ChEMBL | CHEMBL660 |
| ChEBI | CHEBI:2618 |
| EC No. | 212-201-2 |
| DTXSID | DTXSID8022117 |
| 현지명 | 아만타딘 |
화학 및 물리적 성질
| XLogP | 2.4 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 144 |
| 녹는점 | 206-208 °C(lit.) |
| 끓는 점 | 263.29°C (rough estimate) |
| 밀도 | 0.9510 (rough estimate) |
| 굴절률 | 1.5220 (estimate) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 1 M HCl: 용해성 5%, 투명하거나 흐릿함, 무색 내지 희미한 노란색 또는 황갈색 |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 10.1(at 25℃) |
| 색상 | 흰색에서 크림색으로 |
| 용해도 | 유기 용매에 용해됩니다. 물에 불용성. |
| Merck | 14,374 |
| BRN | 2204333 |
| 주요 응용 | 음식 및 음료개인 위생 관리제약 |
| InChI | 1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2/t7-,8+,9-,10- |
| InChIKey | DKNWSYNQZKUICI-UHFFFAOYSA-N |
| SMILES | NC12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| NIST | Tricyclo[3.3.1.13,7]decane-1-amine(768-94-5) |
| EPA | Tricyclo[3.3.1.13,7]decan-1-amine (768-94-5) |
화학적 성질
White to cream powder
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | YD1925000 |
| 독성 | LD50 oral in rat: 900mg/kg |
| 관세 코드 | 29213000 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-36 |
| F 고인화성물질 | 10-34 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 768-94-5(Hazardous Substances Data) |
용도
개요
Amantadine is an agent that raises the concentration of dopamine in the synaptic cleft by releasing it from neurons and suppressing the process of reuptake.
용도
Amantadine is a primary amine derivative of adamantane. It has an effect on mycoviruses, which are RNA-containing viruses. It has a very narrow spectrum of action and is used only for treating and preventing influenza A. It is also used for treating Parkinsonism. The exact mechanism of antiviral action of amantadine is not completely understood. It is believed that it is an ion channel blocker. It has also been suggested that amantadine inhibits absorption of viral particles into the host cell, which is expressed in the breakdown of diffusion of the virus into the cell, or inhibition of the “stripping process” of the virus. The main use is for the prevention of type A2 influenza. Synonyms of this drug are simmetrel, viregit, mantadan, and others.
일반 설명
Amantadine has been used for years as a treatment for Parkinson disease. The adamantanamines have twomechanisms in common:they inhibit an early step in viralreplication, most likely viral uncoating,and in somestrains, they affect a later step that probably involves viral assembly,possibly by interfering with hemagglutinin processing.The main biochemical locus of action is the influenzatype A virus M2 protein, which is an integral membrane proteinthat functions as an ion channel. The M2 channel is a protontransport system. By interfering with the function of theM2 protein, the adamantanamines inhibit acid-mediated dissociationof the ribonucleoprotein complex early in replication.They also interfere with transmembrane proton pumping,maintaining a high intracellular proton concentrationrelative to the extracellular concentration and enhancingacidic pH-induced conformational changes in the hemagglutininduring its intracellular transport at a later stage. The conformationalchanges in hemagglutinin prevent transfer of thenascent virus particles to the cell membrane for exocytosis.