Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Imidocarb
carbesia · midocarb · IMIDOCARB · IMIDOCARB BASE · C19H20N6O2C2H5COOH · Imidocarb USP/EP/BP · C14284500 Imidocarb · Imidocarb (Standard)
식별자 및 물리적 특성
| CAS No. | 27885-92-3 |
|---|---|
| 분자식 | C19H20N6O |
| 평균 분자량 | 348.4 g/mol |
| 단동위원소 질량 | 348.16985926 g/mol |
| SMILES | O=C(Nc1cccc(C2=NCCN2)c1)Nc1cccc(C2=NCCN2)c1 |
| InChIKey | SCEVFJUWLLRELN-UHFFFAOYSA-N |
| PubChem CID | 21389 |
| ChEMBL | CHEMBL427342 |
| ChEBI | CHEBI:51804 |
| EC No. | 248-711-7 |
| DTXSID | DTXSID0048345 |
화학 및 물리적 성질
| XLogP | 0.4 |
|---|---|
| 극성 표면적 | 89.9 |
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 26 |
| 형식 전하 | 0 |
| 복잡도 | 526 |
| Animal Drugs | Pharmaceuticals -> UK Veterinary Medicines Directorate List |
| 녹는점 | >235°C (dec.) |
| 밀도 | 1.39±0.1 g/cm3(Predicted) |
| 저장 조건 | Room Temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨, 가열) |
| pKa(산도 계수) | 13.81±0.70(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1S/C19H20N6O/c26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18/h1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26) |
| InChIKey | SCEVFJUWLLRELN-UHFFFAOYSA-N |
| SMILES | N(C1=CC=CC(C2NCCN=2)=C1)C(NC1=CC=CC(C2NCCN=2)=C1)=O |
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P260, P264, P270, P280, P301+P317, P308+P316, P318, P319, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 36 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | REACH registered substance: Imidocarb (EC: 248-711-7) |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 신호 어 | Danger |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
Imidocarb is a urea derived antiprotozoal agent used in veterinary medicine for the treatment of infection with babesia and other parasites.