Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-(4-(((2,4-Diamino-6-pteridinyl)methyl)amino)benzoyl)glutamic acid
N-[4-[[(2,4-DiaMino-6-pteridinyl)Methyl]aMino]benzoyl]glutaMic Acid · Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]amino]benzoyl]-
식별자 및 물리적 특성
| CAS No. | 1236566-87-2 |
|---|---|
| 분자식 | C19H20N8O5 |
| 평균 분자량 | 440.4 g/mol |
| 단동위원소 질량 | 440.15566577 g/mol |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)cnc2n1 |
| InChIKey | TVZGACDUOSZQKY-UHFFFAOYSA-N |
| PubChem CID | 2154 |
| DTXSID | DTXSID10858993 |
화학 및 물리적 성질
| XLogP | -2 |
|---|---|
| 극성 표면적 | 219 |
| 수소 결합 공여자 수 | 6 |
| 수소 결합 수용자 수 | 12 |
| 회전 가능 결합 수 | 9 |
| 무거운 원자 수 | 32 |
| 형식 전하 | 0 |
| 복잡도 | 674 |
| Physical Description | Solid |
| 저장 조건 | Refrigerator |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | 고체 |
| 색상 | 노란색 |
안전 및 규제
| 독성 요약 | Aminopterin is an amino derivative of folic acid which binds competitively to the dihydrofolate reductase enzyme to block tetrahydrofolate synthesis. Tetrahydrofolate is essential in the production of purines and pyrimadines, thus it's deficiency results in a reduction of DNA, RNA and protein synthesis. |
|---|---|
| Carcinogen Classification | No indication of carcinogenicity to humans (not listed by IARC). |
용도
용도
N-[4-[[(2,4-Diamino-6-pteridinyl)methyl]amino]benzoyl]glutamic Acid is an intermediate in the synthesis of Methotrexate (M260675), a folic acid antagonist, used as a antineoplastic and antirheumatic.