1,3-디페닐이소벤조푸란
1,3-디페닐이소벤조푸란 · DIB · DPBF · Diphenylisobenzofuran · SKL177 · 1,3-DPBF · Diphenylbenzofuran · 1,3-DIPHENYLISOBENZOFURAN
식별자 및 물리적 특성
| CAS No. | 5471-63-6 |
|---|---|
| 분자식 | C20H14O |
| 평균 분자량 | 270.3 g/mol |
| 단동위원소 질량 | 270.10446507 g/mol |
| SMILES | c1ccc(-c2oc(-c3ccccc3)c3ccccc23)cc1 |
| InChIKey | ZKSVYBRJSMBDMV-UHFFFAOYSA-N |
| PubChem CID | 21649 |
| EC No. | 226-808-5 |
| DTXSID | DTXSID40203179 |
| 현지명 | 1,3-디페닐이소벤조푸란 |
화학 및 물리적 성질
| XLogP | 5.6 |
|---|---|
| 극성 표면적 | 13.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 295 |
| 녹는점 | 128-130 °C (lit.) |
| 끓는 점 | 373.44°C (rough estimate) |
| 밀도 | 1.0717 (rough estimate) |
| 굴절률 | 1.6700 (estimate) |
| 저장 조건 | Keep in dark place,Inert atmosphere,2-8°C |
| 물리적 상태 | 결정질 고체 또는 바늘 |
| 색상 | 노란색에서 녹색으로 |
| 용해도 | 톨루엔에 용해됩니다. 물에 불용성. |
| BRN | 199922 |
| InChI | InChI=1S/C20H14O/c1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20(21-19)16-11-5-2-6-12-16/h1-14H |
| InChIKey | ZKSVYBRJSMBDMV-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=C2C(C=CC=C2)=C(C2=CC=CC=C2)O1 |
| NIST | 1,3 Diphenylisobenzofuran(5471-63-6) |
화학적 성질
yellow to greenish needle-like crystalline solid
안전 및 규제
| 규제 정보 | Isobenzofuran, 1,3-diphenyl-: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29329990 |
| 위험 문구(R) | 22-24/25 |
| 안전 문구(S) | 22-24/25 |
| F 고인화성물질 | 8 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
1,3-Diphenylisobenzofuran(DPBF) was used as a fluorescent probe for detection of superoxide anion radical (O2) inside the membrane lipid layer by DPBF fluorescence quenching method. 1,3-Diphenylisobenzofuran(DPBF) was used as quencher during the photoinactivation of TA-3 mouse mammary carcinoma cells containing hematoporphyrin. 1,3-Diphenylisobenzofuran(DPBF) was used to study the single crystal molecular structure and solution photophysical properties of DPBF.
일반 설명
1,3-Diphenylisobenzofuran is a fluorescent dye.1,3-Diphenylisobenzofuran is the model compound in studies of singlet fission.