Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-Methoxy-2-nitrophenol
FR-2322 · NSC 1167 · TIMTEC-BB SBB008609 · 2-Nitro-5-methoxyphenol · 5-METHOZY-2-NITROPHENOL · 3-Methoxy-6-nitrophenol · 5-Methoxy-2-nitrophenol · 3-HYDROXY-4-NITROANISOLE
식별자 및 물리적 특성
| CAS No. | 704-14-3 |
|---|---|
| 분자식 | C7H7NO4 |
| 평균 분자량 | 169.13 g/mol |
| 단동위원소 질량 | 169.0375077 g/mol |
| SMILES | COc1ccc([N+](=O)[O-])c(O)c1 |
| InChIKey | NRTULWPODYLFOJ-UHFFFAOYSA-N |
| PubChem CID | 219635 |
| EC No. | 621-062-0 |
| DTXSID | DTXSID20277212 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 75.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 167 |
| 녹는점 | 92-94 °C(lit.) |
| 끓는 점 | 298.4°C (rough estimate) |
| 밀도 | 1.367 |
| 굴절률 | 1.5830 (rough estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| pKa(산도 계수) | 6.95±0.13(Predicted) |
| 물리적 상태 | 분말 또는 결정 |
| 색상 | 노란색 |
화학적 성질
yellow crystals or powder
안전 및 규제
| GHS 분류 | DangerH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29095000 |
| 위험 문구(R) | 37/38-41-36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 등급 | IRRITANT |
용도
용도
5-Methoxy-2-nitrophenol is a reagent in the synthesis of conformationally constrained spirocycles, which are used as CCR1 antagonists. 5-Methoxy-2-nitrophenol is also used in the preparation of phenylsulfonyl aminophenoxybenzoates which can serve as EP1 receptor antagonists.