Colcemid
COLCEMID · COLCHAMINE · omaine · Colcemide · Tropisteron · (S)-1,2,3,10-Tetramethoxy-7-(methylamino)-6,7-dihydrobenzo[a]heptalen-9(5H)-one · omain · Osamin
식별자 및 물리적 특성
| CAS No. | 477-30-5 |
|---|---|
| 분자식 | C21H25NO5 |
| 평균 분자량 | 371.433 g/mol |
| 단동위원소 질량 | 371.1732729 g/mol |
| SMILES | CN[C@H]1CCc2cc(OC)c(OC)c(OC)c2-c2ccc(OC)c(=O)cc21 |
| InChIKey | NNJPGOLRFBJNIW-HNNXBMFYSA-N |
| PubChem CID | 220401 |
| ChEMBL | CHEMBL312862 |
| ChEBI | CHEBI:4393 |
| EC No. | 207-514-6 |
| DTXSID | DTXSID7020342 |
화학 및 물리적 성질
| 녹는점 | 73-75°C |
|---|---|
| 끓는 점 | 501.11°C (rough estimate) |
| 밀도 | 1.2350 (rough estimate) |
| 굴절률 | 1.5614 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | DMSO: 10mg/mL |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 8.48±0.40(Predicted) |
| 색상 | White to off-white |
| BRN | 2822892 |
| 안정성 | 흡습성 |
| InChI | 1S/C21H25NO5/c1-22-15-8-6-12-10-18(25-3)20(26-4)21(27-5)19(12)13-7-9-17(24-2)16(23)11-14(13)15/h7,9-11,15,22H,6,8H2,1-5H3 |
| InChIKey | NNJPGOLRFBJNIW-UHFFFAOYSA-N |
| SMILES | N(C1CCc2c(c(c(c(c2)OC)OC)OC)C3=CC=C(C(=O)C=C31)OC)C |
화학적 성질
Faintly Yellow Crystalline Powder
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | GH0800000 |
| 운송 번호(UN) | UN 2811 6.1/PG 2 |
| 독성 | LD50 oral in mouse: 25530ug/kg |
| 위험 문구(R) | 25-26/27/28 |
| 위험 표시 | T,T+ |
| 안전 문구(S) | 22-24/25-45-36/37/39 |
| 포장분류 | II |
| 위험 등급 | 6.1(a) |
| F 고인화성물질 | 8-10-23 |
용도
개요
Colcemid is a colchicine derivative that inhibits tubulin polymerization as potently as colchicine (IC50 = 2.1 and 2.4 μM, respectively) but is less toxic. At very low (nanomolar) concentrations, colcemid suppresses microtubule dynamicity and inhibits cell migration, while at micromolar levels it blocks microtubule assembly, arresting cells in metaphase. Mitotic block by colcemid is used to synchronize cells and for karyotyping in cytogenetic studies. Prolonged exposure to colcemid can activate p53, leading to apoptosis.
용도
An antimitotic agent that disrupts microtubles by binding to tubulin and preventing its polymerization. Stimulates the intrinsic GTPase activity of tubulin. Induces apoptosis in several normal and tumor cell lines and activates the JNK/SAPK signaling pathway.
일반 설명
Colcemid is also known as demecolcine. Its generic name is N-methyl-N-deacetyl-colchicine. Colcemid depolymerizes microtubules and blocks mitosis at metaphase.