Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 22273601생성일: 2026년 10월 27일
3-Fluoro-4-(tributylstannyl)pyridine
3-Fluoro-4-(tributylstannyl)pyridine · ributyl-(3-fluoropyridin-4-yl)stannane · Pyridine,3-fluoro-4-(tributylstannyl)- · tributyl-(3-fluoropyridin-4-yl)stannane · 3-Fluoro-4-(tributylstannyl)pyridine >=98%
https://huagongshe.com/ko/chemical/22273601
식별자 및 물리적 특성
| CAS No. | 259807-88-0 |
|---|
| 분자식 | C17H30FNSn |
|---|
| 평균 분자량 | 386.1 g/mol |
|---|
| 단동위원소 질량 | 387.13842288 g/mol |
|---|
| SMILES | CCC[CH2][Sn]([CH2]CCC)([CH2]CCC)[c]1ccncc1F |
|---|
| InChIKey | KKOFZNIMGWDVQS-UHFFFAOYSA-N |
|---|
| PubChem CID | 22273601 |
|---|
| EC No. | 624-310-6 |
|---|
| DTXSID | DTXSID40624163 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 12.9 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 2 |
|---|
| 회전 가능 결합 수 | 10 |
|---|
| 무거운 원자 수 | 20 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 225 |
|---|
| 밀도 | 1.773 g/mL at 25 °C |
|---|
| 저장 조건 | -20°C |
|---|
| 물리적 상태 | liquid |
|---|
| InChI | 1S/C5H3FN.3C4H9.Sn/c6-5-2-1-3-7-4-53*1-3-4-2/h1,3-4H3*1,3-4H2,2H3 |
|---|
| InChIKey | KKOFZNIMGWDVQS-UHFFFAOYSA-N |
|---|
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccncc1F |
|---|
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P260, P264, P264+P265, P270, P273, P280, P301+P316, P302+P352, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P391, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
| 수질 위해 등급(WGK) | 3 |
|---|
| 운송 번호(UN) | UN 2788 6.1/PG 3 |
|---|
| 위험 문구(R) | 21-25-36/38-48/23/25-50/53 |
|---|
| 위험 표시 | T,N |
|---|
| 안전 문구(S) | 35-36/37/39-45-60-61 |
|---|
| 위험 등급 | Acute Tox. 3 OralAcute Tox. 4 DermalAquatic Acute 1Aquatic Chronic 1Eye Irrit. 2Repr. 1BSkin Irrit. 2STOT RE 1 |
|---|
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
|---|
