Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-시클로펜틸-에타논
1-시클로펜틸-에타논 · 1-cyclopentylethan-1-one · ethanone, 1-cyclopentyl- · Acetylcyclopentane · CYCLOPENTYLETHANONE · 1-Acetylcyclopentane · 1-CYCLOPENTYL-ETHANONE · Cyclopentyl(methyl) ketone
식별자 및 물리적 특성
| CAS No. | 6004-60-0 |
|---|---|
| 분자식 | C7H12O |
| 평균 분자량 | 112.17 g/mol |
| 단동위원소 질량 | 112.088815 g/mol |
| SMILES | CC(=O)C1CCCC1 |
| InChIKey | LKENTYLPIUIMFG-UHFFFAOYSA-N |
| PubChem CID | 22326 |
| ChEMBL | CHEMBL5271012 |
| EC No. | 831-763-5 |
| DTXSID | DTXSID20208768 |
| 현지명 | 1-시클로펜틸-에타논 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 90.6 |
| SpringerMaterials Properties | Optical coefficient |
| 녹는점 | 115-116 °C(Solvent: Ethanol) |
| 끓는 점 | 151-156℃ |
| 밀도 | 0.913 |
| 굴절률 | 1.4435 |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색 내지 거의 무색 |
| 용해도 | 물과 섞일 수 있습니다. |
| InChI | InChI=1S/C7H12O/c1-6(8)7-4-2-3-5-7/h7H,2-5H2,1H3 |
| InChIKey | LKENTYLPIUIMFG-UHFFFAOYSA-N |
| SMILES | C(=O)(C1CCCC1)C |
| LogP(분배 계수) | 1.340 (est) |
| NIST | Ethanone, 1-cyclopentyl-(6004-60-0) |
화학적 성질
Colorless Liquid
안전 및 규제
| GHS 분류 | WarningH226 (66.7%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P264, P264+P265, P270, P280, P301+P317, P303+P361+P353, P305+P351+P338, P330, P337+P317, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (66.7%) |
| 관세 코드 | 2914290090 |
| 위험 문구(R) | 22-36 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26 |
| 위험 등급 | IRRITANT |
용도
용도
Cyclopentyl methyl ketone acts as a ligand for Suzuki coupling. Further, it reacts with benzo[1,2,5]oxadiazole 1-oxide to prepare 3-methylspiro(chinoxalin-2(3H),1'-cyclopentan)-3-amin-1,4-dioxide.