Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Chloro-4,6-dimethyl-3-pyridinecarbonitrile
2-CHLORO-4,6-DIMETHYLNICOTINONITRILE · EOS-60842 · AKOS BC-3128 · BUTTPARK 59\40-61 · AKOS BBS-00002510 · IFLAB-BB F1371-0162 · Opicapone Impurity 20 · 6-diMethylnicotinonitrile
식별자 및 물리적 특성
| CAS No. | 14237-71-9 |
|---|---|
| 분자식 | C8H7ClN2 |
| 평균 분자량 | 166.61 g/mol |
| 단동위원소 질량 | 166.0297759 g/mol |
| SMILES | Cc1cc(C)c(C#N)c(Cl)n1 |
| InChIKey | RETJKTAVEQPNMH-UHFFFAOYSA-N |
| PubChem CID | 223261 |
| ChEMBL | CHEMBL1519270 |
| EC No. | 625-186-6 |
| DTXSID | DTXSID50278939 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 36.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 184 |
| 녹는점 | 98-99°C |
| 끓는 점 | 305.3±37.0 °C(Predicted) |
| 밀도 | 1.22±0.1 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | -0.41±0.10(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| BRN | 131348 |
| InChI | InChI=1S/C8H7ClN2/c1-5-3-6(2)11-8(9)7(5)4-10/h3H,1-2H3 |
| InChIKey | RETJKTAVEQPNMH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC(C)=C1C#N |
화학적 성질
White to brown solid
안전 및 규제
| GHS 분류 | DangerH301 (87%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (87%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 3276 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38-41-37/38-25 |
| 위험 표시 | Xi,T |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 3 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |