Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 22375생성일: 2026년 10월 27일
3,7-Dimethylxanthine-1-methanecarboxylic acid
Einecs 227-034-0 · 1-Theobromineacetic acid · 3,7-Dimethylxanthine-1-methanecarboxylic acid · 2,3,6,7-tetrahydro-3,7-dimethyl-2,6-dioxo-1H-purine-1-acetic acid · 1H-Purine-1-acetic acid, 2,3,6,7-tetrahydro-3,7-dimethyl-2,6-dioxo- · 2-(3,7-Dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-1-yl)acetic acid
https://huagongshe.com/ko/chemical/22375
식별자 및 물리적 특성
| CAS No. | 5614-56-2 |
|---|
| 분자식 | C9H10N4O4 |
|---|
| 평균 분자량 | 238.2 g/mol |
|---|
| 단동위원소 질량 | 238.0702048 g/mol |
|---|
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)O)c(=O)n2C |
|---|
| InChIKey | YCTSCXLOPJCPDH-UHFFFAOYSA-N |
|---|
| PubChem CID | 22375 |
|---|
| ChEMBL | CHEMBL67109 |
|---|
| EC No. | 227-034-0 |
|---|
| DTXSID | DTXSID50204672 |
|---|
화학 및 물리적 성질
| XLogP | -0.5 |
|---|
| 극성 표면적 | 95.7 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 5 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 17 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 385 |
|---|
| 녹는점 | 260 °C |
|---|
| 끓는 점 | 562.9±56.0 °C(Predicted) |
|---|
| 밀도 | 1+-.0.1 g/cm3(Predicted) |
|---|
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨, 초음파처리) |
|---|
| 물리적 상태 | 고체 |
|---|
| pKa(산도 계수) | 3.61±0.10(Predicted) |
|---|
| 색상 | 흰색에서 황백색까지 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
|---|
