Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4'-Chloropropiophenone
1-(4-CHLOROPHENYL)PROPAN-2-ONE · 4-CHLOROPROPIOPHENONE · chloropropiophenone · 1-(4-CHLORO-PHENYL)-PROPAN-1-ONE · usafek-5296 · USAF ek-5296 · AKOS B028567 · 4-chlorophenone
식별자 및 물리적 특성
| CAS No. | 6285-05-8 |
|---|---|
| 분자식 | C9H9ClO |
| 평균 분자량 | 168.62 g/mol |
| 단동위원소 질량 | 168.03419259 g/mol |
| SMILES | CCC(=O)c1ccc(Cl)cc1 |
| InChIKey | ADCYRBXQAJXJTD-UHFFFAOYSA-N |
| PubChem CID | 22697 |
| ChEMBL | CHEMBL2251218 |
| EC No. | 228-511-6 |
| DTXSID | DTXSID1048203 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 136 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 35-37 °C(lit.) |
| 끓는 점 | 95-97 °C1 mm Hg(lit.) |
| 밀도 | 1.151 |
| 굴절률 | 1.5325-1.5345 |
| 인화점 | >230 °F |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 거의 흰색 |
| 용해도 | 불용성 |
| BRN | 1100638 |
| InChI | InChI=1S/C9H9ClO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | ADCYRBXQAJXJTD-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1)(=O)CC |
| LogP(분배 계수) | 2.4 |
| NIST | 1-Propanone, 1-(4-chlorophenyl)-(6285-05-8) |
| EPA | 1-Propanone, 1-(4-chlorophenyl)- (6285-05-8) |
화학적 성질
CRYSTALLINE MASS
안전 및 규제
| GHS 분류 | WarningH302 (16.7%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P272, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P333+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 19-09-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/340221-Propanone, 1-(4-chlorophenyl)-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| Hazard Classes and Categories | Acute Tox. 4 (16.7%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | UG9275000 |
| 관세 코드 | 29147000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 37/39-26-24/25 |
| 포장분류 | II |
| 기존화학 물질 | KE-05886 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4'-Chloropropiophenone is a chemical raw material and pharmaceutical intermediate with important application value. It has very important applications in modern pharmaceutical, chemical and biological fields.