식별자 및 물리적 특성
| CAS No. | 25739-67-7 |
|---|
| 분자식 | C23H21N5O6S2 |
|---|
| 평균 분자량 | 527.6 g/mol |
|---|
| 단동위원소 질량 | 527.09332575 g/mol |
|---|
| SMILES | CC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1N=Nc1ccc(C)c(S(=O)(=O)Nc2ccccc2)c1 |
|---|
| InChIKey | DNNYNDQWWWDTPP-UHFFFAOYSA-N |
|---|
| PubChem CID | 22839 |
|---|
| EC No. | 247-224-7 |
|---|
화학 및 물리적 성질
| XLogP | 3 |
|---|
| 극성 표면적 | 175 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 10 |
|---|
| 회전 가능 결합 수 | 7 |
|---|
| 무거운 원자 수 | 36 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 1,070 |
|---|
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 100% (2 of 2) of all reports.Not ClassifiedAggregated GHS information provided per 2 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| 규제 정보 | Chemical: Benzenesulfonic acid, 4-[4,5-dihydro-3-methyl-4-[[4-methyl-3-[(phenylamino)sulfonyl]phenyl]azo]-5-oxo-1H-pyrazol-1-yl]- |
|---|
| 기타 안전 정보 | IMAP assessments - Benzenesulfonic acid, 4-[4,5-dihydro-3-methyl-4-[[4-methyl-3-[(phenylamino)sulfonyl]phenyl]azo]-5-oxo-1H-pyrazol-1-yl]-: Human health tier I assessment |
|---|
| Hazard Classes and Categories | Not Classified |
|---|
