비스페놀 A 다이글리시딜 에테르
비스페놀A다이글리시딜에테르 · 다이페닐올프로페인다이글리시딜에터 · 2,2'-[(1-메틸에틸리덴)비스(4,1-페닐렌옥시메틸렌)]비스옥시레인 · 2,2-비스(4-(2,3-에폭시프로폭시)페닐)프로페인 · 4,4'-비스(2,3-에폭시프로폭시)다이페닐다이메틸메테인 · 다이메틸메테인 다이글리시딜 에터 · 다이페닐올 프로페인 다이글리시딜 에터 · 비스(4-하이드록시페닐)다이메틸메테인 다이글리시딜 에터
식별자 및 물리적 특성
| CAS No. | 1675-54-3 |
|---|---|
| 분자식 | C21H24O4 |
| 평균 분자량 | 340.4 g/mol |
| 단동위원소 질량 | 340.16745924 g/mol |
| SMILES | CC(C)(c1ccc(OCC2CO2)cc1)c1ccc(OCC2CO2)cc1 |
| InChIKey | LCFVJGUPQDGYKZ-UHFFFAOYSA-N |
| PubChem CID | 2286 |
| ChEMBL | CHEMBL258558 |
| ChEBI | CHEBI:34578 |
| EC No. | 216-823-5 |
| DTXSID | DTXSID6024624 |
| 현지명 | 비스페놀 A 다이글리시딜 에테르 |
화학 및 물리적 성질
| XLogP | 4 |
|---|---|
| 극성 표면적 | 43.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 25 |
| 형식 전하 | 0 |
| 복잡도 | 384 |
| 녹는점 | 40-44 °C |
| 끓는 점 | 210 °C / 1mmHg |
| 밀도 | 1,17 g/cm3 |
| 증기압 | 0Pa at 25℃ |
| 굴절률 | 1.5735 |
| 인화점 | 264-268° |
| 저장 조건 | Inert atmosphere,2-8°C |
| 용해도 | DMSO(최대 30mg/ml) 또는 에탄올(최대 15mg/ml)에 용해됩니다. |
| 물리적 상태 | 점성 액체 |
| 색상 | 하얀색 |
| 용해도 | 100% 에탄올, 디메틸 설폭사이드(100mM), 디메틸 포름아미드, 클로로포름, 메탄올 및 에탄올(50mM)에 용해됩니다. 물에 불용성. |
| BRN | 299026 |
| 헨리 상수 | 2.2×105 mol/(m3Pa) at 25℃, HSDB (2015) |
| 안정성 | 제공된 대로 구매일로부터 1년 동안 안정적입니다. DMSO 또는 에탄올 용액은 -20°C에서 최대 1개월 동안 보관할 수 있습니다. |
| 주요 응용 | 청소용품화장품음식 및 음료개인 위생 관리 |
| InChI | 1S/C21H24O4/c1-21(2,15-3-7-17(8-4-15)22-11-19-13-24-19)16-5-9-18(10-6-16)23-12-20-14-25-20/h3-10,19-20H,11-14H2,1-2H3 |
| InChIKey | LCFVJGUPQDGYKZ-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(OCC2CO2)cc1)c3ccc(OCC4CO4)cc3 |
| LogP(분배 계수) | 3.242 at 25℃ |
| EPA | Bisphenol A diglycidyl ether (1675-54-3) |
화학적 성질
Diglycidyl ether of bisphenol A is a colorless to light amber liquid. Slight epoxy odor.
안전 및 규제
| 수질 위해 등급(WGK) | 1 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | TX3800000 |
| 독성 | LD50 oral in rabbit: 1980mg/kg |
| 관세 코드 | 2910900090 |
| 위험 문구(R) | 36/38-43 |
| 위험 표시 | Xi |
| 안전 문구(S) | 28-37/39 |
| 기존화학 물질 | KE-03162 |
| 위험 등급 | Aquatic Chronic 2Eye Irrit. 2Skin Irrit. 2Skin Sens. 1 |
| 저장 분류 | 10 - Combustible liquids |
| 유해 물질 데이터 | 1675-54-3(Hazardous Substances Data) |
용도
개요
Most epoxy resins result from polymerization of bisphenol A diglycidyl ether (BADGE). Delayed hypersensitivity is caused by the low-molecular-weight monomer BADGE (MW 340 g/mol), the dimer having a much lower sensitization power. This allergen caused contact dermatitis in six workers in a plant producing printed circuits boards made of copper sheets and fiberglass fabric impregnated with a brominated epoxy resin. It can also be contained in adhesives.
용도
Bisphenol A derivative. A PPARγ antagonist; exhibits estrogenic activity; An inhibitor of PPARγ and suppressor of TNFα.
일반 설명
Odorless yellowish brown liquid. Sinks in water.
제조 및 합성 방법
생산 방법
The synthesis of the basic epoxy resin molecule involves the reaction of epichlorohydrin with bisphenol A, the latter requiring two basic intermediates for synthesis, acetone and phenol. Theoretically, the production of the bisphenol A diglycidyl ether requires 2 mol of epichlorohydrin for each mole of the phenol. Epoxy resins of higher molecular weight are obtained by reducing the epichlorohydrin/bisphenol A ratio. This reaction involves consumption of the initial epoxy groups in the epichlorohydrin and of some of the groups formed by dehydrohalogenation.