Methyl 1-hydroxy-7-(hydroxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate
enipin · GENIPIN · Jingping · Genipin>GENIPIN(SH) · GENIPIN(RG) · (+)-Genipin · Genipin(AS) · Genipin 95%
![Methyl 1-hydroxy-7-(hydroxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate 분자 구조식](/img/chemical/23340.png)
식별자 및 물리적 특성
| CAS No. | 6902-77-8 |
|---|---|
| 분자식 | C11H14O5 |
| 평균 분자량 | 226.23 g/mol |
| SMILES | COC(=O)C1=COC(O)C2C(CO)=CCC12 |
| InChIKey | AZKVWQKMDGGDSV-UHFFFAOYSA-N |
| PubChem CID | 23340 |
| ChEBI | CHEBI:94318 |
화학 및 물리적 성질
| XLogP | -0.7 |
|---|---|
| 극성 표면적 | 76 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 357 |
| 녹는점 | 120 - 121 °C118.0 to 123.0 °C |
| Physical Description | Solid |
| 끓는 점 | 287.83°C (rough estimate) |
| 밀도 | 1.1230 (rough estimate) |
| 굴절률 | 1.4720 (estimate) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | DMSO: ≥25mg/mL |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 12.06±0.60(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| InChI | InChI=1S/C11H14O5/c1-15-10(13)8-5-16-11(14)9-6(4-12)2-3-7(8)9/h2,5,7,9,11-12,14H,3-4H2,1H3/t7-,9-,11-/m1/s1 |
| InChIKey | AZKVWQKMDGGDSV-BCMRRPTOSA-N |
| SMILES | [C@@H]1(O)OC=C(C(OC)=O)[C@@]2([H])CC=C(CO)[C@@]12[H] |
화학적 성질
It is a white crystalline powder that is soluble in organic solvents such as methanol, ethanol, and DMSO. It is derived from the fruit of Gardenia jasminoides Ellis.
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | GY5828000 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 관세 코드 | 29329990 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 3/14-36/37/39 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 3 Oral |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
Genipin is an active aglycone derived from geniposide, an iridoid glycoside found in the fruit of Gardenia jasminoides Ellis. It has been used in traditional Chinese medicine and is a hydrolytic product of geniposide. Genipin is also known for its inhibitory effect on uncoupling protein 2 (UCP2).
일반 설명
Genipin is a natural cross linking agent, which is extracted from gardenia fruit. It prevents lipid peroxidation and production of nitric oxide. Genipin protects the hippocampal neurons from the toxicity of Alzheimer′s amyloid β protein. It has anti-inflammatory and anti-angiogenesis effects. Genipin is involved in drug delivery system.