Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
7-니트로인돌
7-니트로인돌 · 7-NITRO-1H-INDOLE · 7-N · NSC 69874 · 7-nitro-indol · 7-NITROINDOLE · 7-Nitroindole>7-Nitroindole,97% · 7-Nitroindole,99%
식별자 및 물리적 특성
| CAS No. | 6960-42-5 |
|---|---|
| 분자식 | C8H6N2O2 |
| 평균 분자량 | 162.15 g/mol |
| 단동위원소 질량 | 162.04292743 g/mol |
| SMILES | O=[N+]([O-])c1cccc2cc[nH]c12 |
| InChIKey | LZJGQIVWUKFTRD-UHFFFAOYSA-N |
| PubChem CID | 23396 |
| ChEMBL | CHEMBL164632 |
| EC No. | 677-504-8 |
| DTXSID | DTXSID20219879 |
| 현지명 | 7-니트로인돌 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 61.6 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 190 |
| SpringerMaterials Properties | Chemical shift |
| LogP(분배 계수) | 2.63 |
| 녹는점 | 94-98 °C (lit.) |
| 끓는 점 | 288.82°C (rough estimate) |
| 밀도 | 1.3264 (rough estimate) |
| 굴절률 | 1.5770 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 13.96±0.30(Predicted) |
| 색상 | Light yellow to Yellow to Orange |
| 용해도 | 약간 용해됨 |
| BRN | 130874 |
| InChI | InChI=1S/C8H6N2O2/c11-10(12)7-3-1-2-6-4-5-9-8(6)7/h1-5,9H |
| InChIKey | LZJGQIVWUKFTRD-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2[N+]([O-])=O)C=C1 |
화학적 성질
yellow crystalline powder
안전 및 규제
| GHS 분류 | WarningH302 (12.5%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P318, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (12.5%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | NM1169000 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 68 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 36/37-45 |
| 위험 등급 | IRRITANT-HARMFUL |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
7-Nitroindole is a reagent used in chemical synthesis. It has been used in the synthesis of protein kinase and inosine monophosphate inhibitors, beta3 agonists and CCK-1 receptor modulators. 7-Nitroindole has also been used as a photochemical precursor of the 2'-deoxyribonolactone analog.