Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Butanol, 4-chloro-, 1-acetate
orobutyL · 4-Chlorobutyl acetat · Indocyanine Green 17 · 4-Chlorbut-1-ylacetat · 4-CHLOROBUTYL ACETATE · 4-Acetoxybutyl chloride · 1-Chloro-4-acetoxybutane · 4-Chloro-n-butyl acetate
식별자 및 물리적 특성
| CAS No. | 6962-92-1 |
|---|---|
| 분자식 | C6H11ClO2 |
| 평균 분자량 | 150.6 g/mol |
| 단동위원소 질량 | 150.04475727 g/mol |
| SMILES | CC(=O)OCCCCCl |
| InChIKey | PYLDCZJUHYVOAF-UHFFFAOYSA-N |
| PubChem CID | 23399 |
| EC No. | 230-158-8 |
| DTXSID | DTXSID20884344 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 83.1 |
| SpringerMaterials Properties | Optical coefficient |
| 끓는 점 | 92 °C/22 mmHg (lit.) |
| 밀도 | 1.072 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.434(lit.) |
| 인화점 | 148 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 에틸아세테이트(약간 용해됨) |
| 물리적 상태 | 기름 |
| 색상 | 투명 무색 |
| 비중 | 1.08 |
| 용해도 | 물과 호환되지 않음 |
| BRN | 1749681 |
| InChI | InChI=1S/C6H11ClO2/c1-6(8)9-5-3-2-4-7/h2-5H2,1H3 |
| InChIKey | PYLDCZJUHYVOAF-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)CCCCl |
| NIST | 1-Butanol, 4-chloro-, acetate(6962-92-1) |
| EPA | 1-Butanol, 4-chloro-, acetate (6962-92-1) |
화학적 성질
clear colorless liquid
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 24-07-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/20067 |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | EL1328000 |
| 운송 번호(UN) | 3272 |
| 관세 코드 | 2915907098 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36-37/39 |
| 포장분류 | III |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
4-Chlorobutyl Acetate is a reagent used in the synthesis of novel cyclic ADP ribose derivatives. Also used in the synthesis of a transient receptor potential melastatin 2 antagonist involved in insulin secretion.