Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-티오펜아세트산
3-티오펜아세트산 · THIOPHENE-3-ACETIC ACID · Thiophen-3-ylacetic acid · Mefluleucine · 3-Thiopheneacetic · TIMTEC-BB SBB004147 · RARECHEM AL BO 0216 · Ticarcillin EP Imp B
식별자 및 물리적 특성
| CAS No. | 6964-21-2 |
|---|---|
| 분자식 | C6H6O2S |
| 평균 분자량 | 142.18 g/mol |
| 단동위원소 질량 | 142.00885043 g/mol |
| SMILES | O=C(O)Cc1ccsc1 |
| InChIKey | RCNOGGGBSSVMAS-UHFFFAOYSA-N |
| PubChem CID | 23404 |
| EC No. | 230-166-1 |
| DTXSID | DTXSID10219904 |
| 현지명 | 3-티오펜아세트산 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 65.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 114 |
| 물질 분류 | Other Classes -> Organic Acids |
| Physical Description | Beige powder[Sigma-Aldrich MSDS] |
| 녹는점 | 73-76 °C(lit.) |
| 끓는 점 | 129°C 2,5mm |
| 밀도 | 1.365 (estimate) |
| 굴절률 | 1.5300 (estimate) |
| 인화점 | 129°C/2.5mm |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| pKa(산도 계수) | 4.25±0.10(Predicted) |
| 물리적 상태 | 결정질 플레이크 또는 분말 |
| 색상 | 미색부터 베이지까지 |
| 용해도 | 물에 매우 잘 녹습니다. |
| BRN | 113622 |
| InChI | InChI=1S/C6H6O2S/c7-6(8)3-5-1-2-9-4-5/h1-2,4H,3H2,(H,7,8) |
| InChIKey | RCNOGGGBSSVMAS-UHFFFAOYSA-N |
| SMILES | C1SC=CC=1CC(O)=O |
| NIST | 3-Thiopheneacetic acid(6964-21-2) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | DangerH314 (17.4%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P319, P321, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | Intravenous LD50 (mouse) = 985 mg/kg[RTECS] A skin and strong eye irritant[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Skin Corr. 1B (17.4%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | XM7570000 |
| 운송 번호(UN) | 1759 |
| 관세 코드 | 29349990 |
| 위험 문구(R) | 36/37/38-34 |
| 위험 표시 | Xi,C |
| 안전 문구(S) | 26-24/25-45-36/37/39-27 |
| 포장분류 | III |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
3-Thiopheneacetic acid was used in one-step, size control synthesis of gold nanoparticles. It was also used in the preparation of gold nanoparticles capped with 3-thiopheneacetic acid (3-TAA) via borohydride reduction.
일반 설명
3-Thiopheneacetic acid acts as monocarboxylate ligand and forms oxo-carboxylate bridged digadolinium(III) complexes. Electrochemical oxidation of 3-thiopheneacetic acid in dry acetonitrile leads to the formation of a conducting polymeric film of poly (3-thiopheneacetic acid).