3-쿠마라논
3-쿠마라논 · BENZOFURAN-3(2H)-ONE · 3(2H)-BENZOFURANONE · COUMARANONE · Coumaran-3-one · 2,3-dihydro-1-benzofuran-3-one · 3-Oxocoumaran · 3-Coumaranone
식별자 및 물리적 특성
| CAS No. | 7169-34-8 |
|---|---|
| 분자식 | C8H6O2 |
| 평균 분자량 | 134.13 g/mol |
| 단동위원소 질량 | 134.03677943 g/mol |
| SMILES | O=C1COc2ccccc21 |
| InChIKey | MGKPCLNUSDGXGT-UHFFFAOYSA-N |
| PubChem CID | 23556 |
| ChEMBL | CHEMBL2253270 |
| EC No. | 640-279-1 |
| DTXSID | DTXSID20221917 |
| 현지명 | 3-쿠마라논 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 153 |
| 녹는점 | 101-103 °C |
| 끓는 점 | 207.23°C (rough estimate) |
| 밀도 | 1.1603 (rough estimate) |
| 굴절률 | 1.4800 (estimate) |
| 저장 조건 | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| 용해도 | 클로로포름 (약간 용해됨), DMSO (약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 8.66 |
| 색상 | 노란색에서 진한 노란색까지 |
| 용해도 | 물과 약간 섞임. |
| BRN | 115296 |
| InChI | InChI=1S/C8H6O2/c9-7-5-10-8-4-2-1-3-6(7)8/h1-4H,5H2 |
| InChIKey | MGKPCLNUSDGXGT-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C(=O)C1 |
| NIST | 3(2H)-benzofuranone(7169-34-8) |
화학적 성질
white to light yellow crystal powde
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 관세 코드 | 29329990 |
| 위험 문구(R) | 36/37/38-20/21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 22-24/25-36/37/39-26-36 |
| F 고인화성물질 | 4.5-9 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3-Coumaranone is used in the aurones, [2-benzylidenebenzofuran-3(2H)-ones] by reacting with appropriate aldehyde. It is involved in the condensation reaction with aldehydes in the presence of morpholine acetate to prepare substituted 2-(arylidene)benzofuran-3(ZH)-ones. In Horner-Wadsworth-Emmons reaction, it reacts with diethyl cyanomethylphosphonate to give 3-(cyanomethyl)benzofurans, which is an intermediate in the synthesis of antihyperglycemic agents.
일반 설명
Benzofuran-3(2H)-one undergoes condensation with aldehydes in the presence of morpholine acetate to yield substituted 2-(arylidene)benzofuran-3(ZH)-ones. It undergoes acid- or base-catalyzed condensation with an appropriate aldehyde to yield aurones [2-benzylidenebenzofuran-3(2H)-ones].