Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
메틸3-브로모-5-니트로벤조에이트
메틸3-브로모-5-니트로벤조에이트 · DK89898D · Methyl 3-bromo-5-nitrobenzoate · 3-Bromo-5-nitro-benzoic acid met · Methyl3-bromo-5-nitrobenzoate98% · Methyl 3-bromo-5-nitrobenzoate 98% · 3-Bromo-5-nitro-benzoic acid methyl ester · Benzoic acid, 3-bromo-5-nitro-, methyl ester
식별자 및 물리적 특성
| CAS No. | 6307-87-5 |
|---|---|
| 분자식 | C8H6BrNO4 |
| 평균 분자량 | 260.04 g/mol |
| 단동위원소 질량 | 258.94801977 g/mol |
| SMILES | COC(=O)c1cc(Br)cc([N+](=O)[O-])c1 |
| InChIKey | DDJCZBFPZLYREP-UHFFFAOYSA-N |
| PubChem CID | 239341 |
| EC No. | 692-875-6 |
| DTXSID | DTXSID80286229 |
| 현지명 | 메틸3-브로모-5-니트로벤조에이트 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 72.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 240 |
| 녹는점 | 70 °C(Solv: ethanol (64-17-5)) |
| 끓는 점 | 326.0±22.0 °C(Predicted) |
| 밀도 | 1.673±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 고체 |
| 색상 | 황백색부터 연한 갈색까지 |
| InChI | InChI=1S/C8H6BrNO4/c1-14-8(11)5-2-6(9)4-7(3-5)10(12)13/h2-4H,1H3 |
| InChIKey | DDJCZBFPZLYREP-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC([N+]([O-])=O)=CC(Br)=C1 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2916399090 |
| 위험 표시 | Xi |
| 위험 참고 사항 | Irritant |
용도
용도
Methyl 3-bromo-5-nitrobenzoate is a pharmaceutical intermediate. Methyl 3-bromo-5-nitrobenzoate can be used to prepare 3-amidobenzoic acid derivatives such as 3-(4-trifluoromethylbenzoyl)amino-5-(2',6'-(2H)piperidinylphenyl)benzoic acid, which have P2Y receptor antagonist effects.