1,1-Diethoxy-3,7-dimethyl-2,6-octadiene
FEMA 2304 · 1,1-Diethoxy-3,7-dim · Citral diethyl aceta · CITRAL DIETHYL ACETAL · Citral diet-llvl acetaI · CITRAL-DIETHYLACETAL 'R' · CITRAL DIETHYL ACETAL 93+% · Citral Diethyl Acetal Natural
식별자 및 물리적 특성
| CAS No. | 7492-66-2 |
|---|---|
| 분자식 | C14H26O2 |
| 평균 분자량 | 226.35 g/mol |
| 단동위원소 질량 | 226.19328007 g/mol |
| SMILES | CCOC(C=C(C)CCC=C(C)C)OCC |
| InChIKey | NTXGFKWLJFHGGJ-UHFFFAOYSA-N |
| PubChem CID | 24113 |
| DTXSID | DTXSID1024837 |
화학 및 물리적 성질
| XLogP | 4.2 |
|---|---|
| 극성 표면적 | 18.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 219 |
| 끓는 점 | 140-142 °C15 mm Hg(lit.) |
| 밀도 | 0.875 g/mL at 25 °C(lit.) |
| 증기압 | 2.13Pa at 25℃ |
| FEMA | 2304 | CITRAL DIETHYL ACETAL |
| 굴절률 | n20/D 1.449(lit.) |
| 인화점 | 174 °F |
| 저장 조건 | 2-8°C |
| 용해도 | Very slightly soluble in water, soluble in alcohol, fairly soluble in Propylene glycol, miscible with most perfume and flavor oils. |
| 색상 | Colorless, slightly oily liquid |
| 냄새 | 100.00%에서. 녹색 신선한 감귤류 레몬 껍질 밀랍 |
| 향취 유형 | 감귤류 |
| 생물학적 소스 | synthetic |
| 용해도 | 1g/L at 25℃ |
| JECFA Number | 948 |
| 안정성 | 안정적인. 타기 쉬운. 강한 산화제와 호환되지 않습니다. 습기에 민감할 수 있습니다. |
| 주요 응용 | 향료 및 향 |
| 화장품 원료 기능 | 향수 |
| InChI | 1S/C14H26O2/c1-6-15-14(16-7-2)11-13(5)10-8-9-12(3)4/h9,11,14H,6-8,10H2,1-5H3/b13-11+ |
| InChIKey | NTXGFKWLJFHGGJ-ACCUITESSA-N |
| SMILES | CCOC(OCC)\C=C(/C)CC\C=C(/C)C |
| LogP(분배 계수) | 4.82 |
| EPA | Citral diethyl acetal (7492-66-2) |
화학적 성질
colourless liquid
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | RG5080000 |
| 운송 번호(UN) | 1993 |
| 포장분류 | III |
| 위험 등급 | 3.2 |
| 기존화학 물질 | KE-10340 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Since Citral Diethyl Acetal is stable in soap, it can be used in such fraBances, but should not be considered anything near a substitute for Citral as an odor. Used in flavor compositions, mainly in Citrus flavors along with natural oils and synthetic flavor chemicals. It will introduce quite natural green-oily, “peel” notes in Lemon and Lime, and it can be twisted into an Orange with the proper background materials. Concentration in the finished product is usually about 100 ppm in condiments, (lower in other products).
일반 설명
Clear colorless liquid.
제조 및 합성 방법
제조 방법
From ethyl orthoformate and citral.