Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Amino-4-methyl-3-nitropyridine
2-AMINO-4-METHYL-3-NITROPYRIDINE · NSC 52453 · TIMTEC-BB SBB006636 · 4-METHYL-3-NITRO-PYRI · 2-AMINO-3-NITRO-4-PICOLINE · 2-AMino-4-Methyl-3-nitrop... · 2-Amino-3-nitro-4-picoline,98% · 4-Methyl-3-nitro-2-pyridinamine
식별자 및 물리적 특성
| CAS No. | 6635-86-5 |
|---|---|
| 분자식 | C6H7N3O2 |
| 평균 분자량 | 153.14 g/mol |
| 단동위원소 질량 | 153.05382646 g/mol |
| SMILES | Cc1ccnc(N)c1[N+](=O)[O-] |
| InChIKey | IKMZGACFMXZAAT-UHFFFAOYSA-N |
| PubChem CID | 243166 |
| ChEMBL | CHEMBL3981727 |
| EC No. | 626-702-2 |
| DTXSID | DTXSID80287771 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 84.7 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 156 |
| 녹는점 | 136-140 °C(lit.) |
| 끓는 점 | 276.04°C (rough estimate) |
| 밀도 | 1.3682 (rough estimate) |
| 굴절률 | 1.6500 (estimate) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 2.97±0.47(Predicted) |
| 색상 | 노란색 |
| BRN | 139111 |
| InChI | InChI=1S/C6H7N3O2/c1-4-2-3-8-6(7)5(4)9(10)11/h2-3H,1H3,(H2,7,8) |
| InChIKey | IKMZGACFMXZAAT-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(C)=C1[N+]([O-])=O |
| NIST | Pyridine, 2-amino-3-nitro-4-methyl-(6635-86-5) |
화학적 성질
light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29333999 |
| 위험 문구(R) | 36/37/38-20/21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36-36/37/39-22 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| F 고인화성물질 | 10 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Amino-4-methyl-3-nitropyridine was used in the synthesis of 2-amino-5-hydroxy-4-methyl-3-nitropyridine, 2-amino-4-hydroxymethyl-3-nitropyridine and 2-amino-4-methyl-3-nitropyridine-1-oxide by undergoing biotransformation by Cunninghamella elegans ATCC 26269.
일반 설명
The crystal structure of 2-amino-4-methyl-3-nitropyridine was elucidated.