Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-Amino-2-methylpyridine
6-Methylpyridin-3-amine · 5-AMINO-2-PICOLINE · 3-AMINO-6-METHYLPYRIDINE · 6-METHYL-PYRIDIN-3-YLAMINE · AURORA KA-7923 · 5-Aminopicoline · 3-AMINO-6-PICOLINE · 5-Amino-2-methylpyri
식별자 및 물리적 특성
| CAS No. | 3430-14-6 |
|---|---|
| 분자식 | C6H8N2 |
| 평균 분자량 | 108.14 g/mol |
| 단동위원소 질량 | 108.06874826 g/mol |
| SMILES | Cc1ccc(N)cn1 |
| InChIKey | UENBBJXGCWILBM-UHFFFAOYSA-N |
| PubChem CID | 243313 |
| EC No. | 625-232-5 |
| DTXSID | DTXSID00287854 |
화학 및 물리적 성질
| XLogP | 0.5 |
|---|---|
| 극성 표면적 | 38.9 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 72.9 |
| 녹는점 | 95-99°C |
| 끓는 점 | 238.4±20.0 °C(Predicted) |
| 밀도 | 1.068±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| pKa(산도 계수) | 6.89±0.10(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 황백색에서 주황색, 갈색까지 |
| InChI | InChI=1S/C6H8N2/c1-5-2-3-6(7)4-8-5/h2-4H,7H2,1H3 |
| InChIKey | UENBBJXGCWILBM-UHFFFAOYSA-N |
| SMILES | C1=NC(C)=CC=C1N |
| LogP(분배 계수) | 0.704 |
화학적 성질
White to orange to brown solid
안전 및 규제
| GHS 분류 | DangerH301 (12.5%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P262, P264, P264+P265, P270, P271, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 07-06-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/29319 |
| Hazard Classes and Categories | Acute Tox. 3 (12.5%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN2811 |
| 관세 코드 | 29333999 |
| 위험 문구(R) | 22-37/38-41-36/37/38-34-24/25 |
| 위험 표시 | Xn,Xi,C |
| 안전 문구(S) | 26-36/39-45-36/37/39-36-27-36/37 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Harmful |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
6-Methylpyridine-3-amine, is a heterocyclic building block used in the manufacture of various pharmaceutical compounds. It can be used for the synthesis of 2-aminoquinazoline derivatives, as a novel class of metabotropic glutamate receptor 5 negative allosteric modulators (mGluR5), leading toward a drug candidate for the treatment of l-DOPA induced dyskinesia.
일반 설명
5-Amino-2-methylpyridine is used as a pharmaceutical intermediate for Omecamtiv Mecarbil, a selective cardiac myosin activator used to improve cardiac function.