Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-니트로-1H-퀴놀린-2-온
5-니트로-1H-퀴놀린-2-온 · 5-nitroquinolin-2(1H)-one · NSC 53940 · 5-Nitrocarbostyril · 5-nitro-1H-quinolin-2-one · 2(1H)-Quinolinone, 5-nitro-
식별자 및 물리적 특성
| CAS No. | 6938-27-8 |
|---|---|
| 분자식 | C9H6N2O3 |
| 평균 분자량 | 190.16 g/mol |
| 단동위원소 질량 | 190.03784205 g/mol |
| SMILES | O=c1ccc2c([N+](=O)[O-])cccc2[nH]1 |
| InChIKey | NRZABPOFVNBWMI-UHFFFAOYSA-N |
| PubChem CID | 243776 |
| ChEMBL | CHEMBL2042584 |
| EC No. | 832-522-7 |
| DTXSID | DTXSID70288050 |
| 현지명 | 5-니트로-1H-퀴놀린-2-온 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 74.9 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 295 |
| 녹는점 | 245-247℃ |
| 끓는 점 | 422.1±45.0 °C(Predicted) |
| 밀도 | 1.419 |
| 저장 조건 | 2-8°C, stored under nitrogen |
| 용해도 | 메탄올, 에틸아세테이트에 용해됨 |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 10.54±0.70(Predicted) |
| 색상 | 노란색 |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 관세 코드 | 2933499090 |
용도
용도
5-Nitro-1H-quinolin-2-one is used in the synthetic preparation of novel antileishmanial agents for Leishmania donovani promastigotes.