Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-Bromoindole
5-BROMO-1H-INDOLE · 5-BI · SW-43 · SWF-43 · B2310G25 · 5-Bromindole · 5-BROMOINDOLE · 5-bromonindole
식별자 및 물리적 특성
| CAS No. | 10075-50-0 |
|---|---|
| 분자식 | C8H6BrN |
| 평균 분자량 | 196.04 g/mol |
| 단동위원소 질량 | 194.96836129 g/mol |
| SMILES | Brc1ccc2[nH]ccc2c1 |
| InChIKey | VXWVFZFZYXOBTA-UHFFFAOYSA-N |
| PubChem CID | 24905 |
| ChEMBL | CHEMBL325917 |
| ChEBI | CHEBI:232364 |
| EC No. | 233-208-7 |
| DTXSID | DTXSID6073996 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 15.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 126 |
| SpringerMaterials Properties | 15N nuclear magnetic resonance spectrum |
| 녹는점 | 90-92 °C (lit.) |
| 끓는 점 | 228.5°C (rough estimate) |
| 밀도 | 1.5466 (rough estimate) |
| 굴절률 | 1.6550 (estimate) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| 용해도 | 126mg/l(계산) |
| 물리적 상태 | 분말 또는 덩어리 |
| pKa(산도 계수) | 16.04±0.30(Predicted) |
| 색상 | 흰색에서 밝은 갈색까지 |
| BRN | 112877 |
| InChI | InChI=1S/C8H6BrN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
| InChIKey | VXWVFZFZYXOBTA-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C=C1 |
| EPA | 1H-Indole, 5-bromo- (10075-50-0) |
화학적 성질
white to light brown powder or chunks
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 13.6% (8 of 59) of reports.WarningH315 (86.4%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 59 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 25-03-2021 https://echa.europa.eu/registration-dossier/-/registered-dossier/23422 |
| Hazard Classes and Categories | Skin Irrit. 2 (86.4%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29339990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-24/25-37/39 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
A potential inhibitor of GSK-3