Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Caprylyltrimethylammonium chloride
TRIMETHYLOCTYLAMMONIUM CHLORIDE · TOACL · OTMACl · [M3C8N]Cl · CH3(CH2)7N(CH3)3(Cl) · TriMethyloctylaMMoniuM chlorid · TriMethyOctylAmmonium Chloride · OCLyltriMethylaMMoniuM Chloride
식별자 및 물리적 특성
| CAS No. | 10108-86-8 |
|---|---|
| 분자식 | C11H26ClN |
| 평균 분자량 | 207.78 g/mol |
| 단동위원소 질량 | 207.17537751 g/mol |
| SMILES | CCCCCCCC[N+](C)(C)C.[Cl-] |
| InChIKey | AQZSPJRLCJSOED-UHFFFAOYSA-M |
| PubChem CID | 24949 |
| EC No. | 627-224-7 |
| DTXSID | DTXSID90905939 |
화학 및 물리적 성질
| 극성 표면적 | 0 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 91.7 |
| 저장 조건 | Storage temp. 2-8°C |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 거의 흰색 |
| 용해도 | 거의 투명함 |
| BRN | 4005082 |
| InChI | 1S/C11H26N.ClH/c1-5-6-7-8-9-10-11-12(2,3)4/h5-11H2,1-4H31H/q+1/p-1 |
| InChIKey | AQZSPJRLCJSOED-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCCCCCC[N+](C)(C)C |
| EPA | Trimethyloctylammonium chloride (10108-86-8) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29239000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39-36-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Trimethyloctylammonium chloride (TOMAC) is a cationic surfactant that can be used: To separate SiC from ground SiO2 by flotation method. To prepare porous organosilicates using 1,2-bis(trimethoxysilyl)ethane as a silica precursor.