Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-(1-methyl-1H-indol-3-yl)acetic acid
1-METHYLINDOLE-3-ACETIC ACID · NSC 78007 · RARECHEM AH BS 0119 · IFLAB-BB F1920-0023 · 1-Methyl-3-indoleacetic acid · 2-(1-methylindol-3-yl)aceticaci · 1-METHYL-3-INDOLEACETIC ACID 98% · 2-(1-methylindol-3-yl)acetic acid
식별자 및 물리적 특성
| CAS No. | 1912-48-7 |
|---|---|
| 분자식 | C11H11NO2 |
| 평균 분자량 | 189.21 g/mol |
| 단동위원소 질량 | 189.07897859 g/mol |
| SMILES | Cn1cc(CC(=O)O)c2ccccc21 |
| InChIKey | NAIPEFIYIQFVFC-UHFFFAOYSA-N |
| PubChem CID | 254166 |
| ChEMBL | CHEMBL85031 |
| EC No. | 693-051-9 |
| DTXSID | DTXSID20291791 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 42.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 229 |
| 녹는점 | 126-128 °C (lit.) |
| 끓는 점 | 392.0±17.0 °C(Predicted) |
| 밀도 | 1.20±0.1 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름, 메탄올에 용해됨 |
| pKa(산도 계수) | 4.53±0.30(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 흰색에서 황갈색까지 |
| InChI | InChI=1S/C11H11NO2/c1-12-7-8(6-11(13)14)9-4-2-3-5-10(9)12/h2-5,7H,6H2,1H3,(H,13,14) |
| InChIKey | NAIPEFIYIQFVFC-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=CC=C2)C(CC(O)=O)=C1 |
화학적 성질
Light Brown Solid
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2933998090 |
| 위험 문구(R) | 22-37/38-41 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-39 |
| 위험 등급 | IRRITANTAcute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
1-Methylindole-3-acetic Acid is a N-methylated derivative of Indole-3-acetic acid, a natural auxin, with plant growth regulating activity.
일반 설명
1-Methyl-3-indoleacetic acid is an indole derivative. Direct and riboflavin- or Rose-Bengal-sensitized photo-oxidation of 1-methyl-3-indoleacetic acid in aqueous buffer (pH 5 or pH 8) containing 10% methanol has been studied.