Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Bis(p-nitrophenyl) phosphate
BNPP · di-p-nitrophenylphosphate · Di-p-nitrophenyl phosphate · Di-4-nitrophenyl phosphate · BIS(P-NITROPHENYL)PHOSPHATE · BIS(4-NITROPHENYL) PHOSPHATE · p-nitro-phenohydrogenphosphate · DI-P-NITROPHENYLPHOSPHORIC ACID
식별자 및 물리적 특성
| CAS No. | 645-15-8 |
|---|---|
| 분자식 | C12H9N2O8P |
| 평균 분자량 | 340.18 g/mol |
| 단동위원소 질량 | 340.00965188 g/mol |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChIKey | MHSVUSZEHNVFKW-UHFFFAOYSA-N |
| PubChem CID | 255 |
| ChEMBL | CHEMBL1231178 |
| ChEBI | CHEBI:3122 |
| EC No. | 211-434-7 |
| DTXSID | DTXSID20870742 |
화학 및 물리적 성질
| XLogP | 1 |
|---|---|
| 극성 표면적 | 147 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 23 |
| 형식 전하 | 0 |
| 복잡도 | 434 |
| 녹는점 | 172-175 °C(lit.) |
| 끓는 점 | 545.7±60.0 °C(Predicted) |
| 밀도 | 1.614±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | DMSO (Slightly), Isopropanol (Slightly), Methanol |
| pKa(산도 계수) | 1.04±0.50(Predicted) |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 거의 흰색 |
| 용해도 | 거의 투명함 |
| InChI | InChI=1S/C12H9N2O8P/c15-13(16)9-1-5-11(6-2-9)21-23(19,20)22-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,19,20) |
| InChIKey | MHSVUSZEHNVFKW-UHFFFAOYSA-N |
| SMILES | P(O)(OC1=CC=C([N+]([O-])=O)C=C1)(OC1=CC=C([N+]([O-])=O)C=C1)=O |
| NIST | Phosphoric acid, bis(p-nitrophenyl) ester(645-15-8) |
| EPA | Bis(p-nitrophenyl) phosphate (645-15-8) |
화학적 성질
Bis(4-nitrophenyl) phosphate is Light Brown Powder
안전 및 규제
| GHS 분류 | DangerH300 (95.2%): Fatal if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 2 (95.2%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | TB8260000 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 관세 코드 | 29199000 |
| 위험 문구(R) | 25 |
| 위험 표시 | T |
| 안전 문구(S) | 45 |
| 위험 등급 | 6.1Acute Tox. 2 Oral |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
용도
용도
Bis(4-nitrophenyl) phosphate(BNPP) has been used as substrate to determine the enzyme activity of root phosphodiesterases of wetland plants. BNPP has been used to study the mechanism of cleavage of BNPP using oxamido-bridged dinuclear copper(II) complexes as catalysts.