Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 257520생성일: 2026년 11월 2일
3,3,6,6-Tetrachloro-2,5-bis(4-methylphenyl)-1,4,2,5-dithiadiazinane
3,3,6,6-TETRACHLORO-2,5-BIS(4-METHYLPHENYL)-1,4,2,5-DITHIADIAZINANE · 1,4,2,5-Dithiadiazine,3,3,6,6-tetrachlorotetrahydro-2,5-bis(4-methylphenyl)-
https://huagongshe.com/ko/chemical/257520
식별자 및 물리적 특성
| CAS No. | 18715-75-8 |
|---|
| 분자식 | C16H14Cl4N2S2 |
|---|
| 평균 분자량 | 440.2 g/mol |
|---|
| 단동위원소 질량 | 437.935252 g/mol |
|---|
| SMILES | Cc1ccc(N2SC(Cl)(Cl)N(c3ccc(C)cc3)SC2(Cl)Cl)cc1 |
|---|
| InChIKey | UUILSIQOYGCVPZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 257520 |
|---|
| EC No. | 145-972-8 |
|---|
| DTXSID | DTXSID10292797 |
|---|
화학 및 물리적 성질
| XLogP | 8 |
|---|
| 극성 표면적 | 57.1 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 24 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 396 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
