Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Carteolol
C06874 · Carteolol · dl-Carteolol · Carteolol USP/EP/BP · Carteolol Impurities1808 · Carteolol (base and/or unspecified salts) · 5-[3-(tert-Butylamino)-2-hydroxypropoxy]-3,4-dihydrocarbostyril · 5-(2-Hydroxy-3-tert-butylaminopropoxy)-3,4-dihydro-2(1H)-quinolone
식별자 및 물리적 특성
| CAS No. | 51781-06-7 |
|---|---|
| 분자식 | C16H24N2O3 |
| 평균 분자량 | 292.37 g/mol |
| 단동위원소 질량 | 292.17869263 g/mol |
| SMILES | CC(C)(C)NCC(O)COc1cccc2c1CCC(=O)N2 |
| InChIKey | LWAFSWPYPHEXKX-UHFFFAOYSA-N |
| PubChem CID | 2583 |
| ChEMBL | CHEMBL839 |
| ChEBI | CHEBI:3437 |
| DTXSID | DTXSID3022746 |
화학 및 물리적 성질
| XLogP | 1 |
|---|---|
| 극성 표면적 | 70.6 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 354 |
| LogP(분배 계수) | 1.11.49 |
| 용해도 | 4.21e-01 g/L |
| Human Drugs | Breast FeedingLactationMilk, HumanAdrenergic Beta-AntagonistsAntiglaucoma AgentsPharmaceuticals |
| Physical Description | Solid |
| 끓는 점 | 434.3°C (rough estimate) |
| 밀도 | 1.0574 (rough estimate) |
| 굴절률 | 1.5800 (estimate) |
| pKa(산도 계수) | 13.84±0.20(Predicted) |
안전 및 규제
| Effects During Pregnancy and Lactation | ◉ Summary of Use during Lactation |
|---|
용도
용도
Antiadrenergic (β-receptor).