Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-(4-Aminophenyl)butanoic acid
AKOS BB-8810 · 4-Amino-benzenebutanoic · p-Aminophenylbutyricacid · 4-Aminophenylbutyric Acid · 4-Aminobenzenebutanoic acid · 4-(4-AMINOPHENYL)BUTYRIC ACID · 4-(4-Aminophenyl)butanoicacid · Benzenebutanoic acid, 4-amino-
식별자 및 물리적 특성
| CAS No. | 15118-60-2 |
|---|---|
| 분자식 | C10H13NO2 |
| 평균 분자량 | 179.22 g/mol |
| 단동위원소 질량 | 179.09462866 g/mol |
| SMILES | Nc1ccc(CCCC(=O)O)cc1 |
| InChIKey | RBHLFWNKEWLHBP-UHFFFAOYSA-N |
| PubChem CID | 27049 |
| ChEMBL | CHEMBL1650245 |
| EC No. | 628-142-4 |
| DTXSID | DTXSID50164727 |
화학 및 물리적 성질
| XLogP | 1.7 |
|---|---|
| 극성 표면적 | 63.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 162 |
| 녹는점 | 121-124 °C (lit.) 121-133 °C |
| 끓는 점 | 363.7±17.0 °C(Predicted) |
| 밀도 | 1.177±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 4.70±0.10(Predicted) |
| 색상 | 라이트 베이지부터 라이트 브라운까지 |
| 주요 응용 | 펩타이드 합성 |
| InChI | InChI=1S/C10H13NO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3,11H2,(H,12,13) |
| InChIKey | RBHLFWNKEWLHBP-UHFFFAOYSA-N |
| SMILES | C1(CCCC(O)=O)=CC=C(N)C=C1 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2922498590 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
4-(4-Aminophenyl)butyric acid (4-APB) is an important organic compound derived from butyric acid, which is used as a synthetic intermediate for pharmaceuticals or the synthesis of various compounds. It is also used in drug mechanism studies and is thought to be an agonist for certain G-protein coupled receptors and may also interact with other proteins in the signal transduction pathway. In addition, 4-(4-aminophenyl)butyric acid has been found to inhibit monoamine oxidase, which plays a role in neurotransmitter catabolism.