Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Benzenemethanamine, 3-nitro-, hydrochloride (1:1)
SKL922 · m-NitrobenzylamineHCl · 3-NITROBENZYLAMINE HCL · 3-NitrobenzylamineHydrochlori · BENZENE DERIVATIVE 26177-43-5 · 3-NitrobenzylamineHydrochloric · 3-NITROBENZYLAMINE HYDROCHLORIDE · M-NITROBENZYLAMINE HYDROCHLORIDE
식별자 및 물리적 특성
| CAS No. | 26177-43-5 |
|---|---|
| 분자식 | C7H9ClN2O2 |
| 평균 분자량 | 188.61 g/mol |
| 단동위원소 질량 | 188.03525521 g/mol |
| SMILES | Cl.NCc1cccc([N+](=O)[O-])c1 |
| InChIKey | DLZXLCHQWOZGSE-UHFFFAOYSA-N |
| PubChem CID | 2724030 |
| ChEMBL | CHEMBL13978 |
| EC No. | 247-502-8 |
| DTXSID | DTXSID20949048 |
화학 및 물리적 성질
| 극성 표면적 | 71.8 |
|---|---|
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 144 |
| 녹는점 | 229-231 °C(lit.) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | 고체 |
| 색상 | 회백색부터 황갈색까지 |
| InChI | 1S/C7H8N2O2.ClH/c8-5-6-2-1-3-7(4-6)9(10)11/h1-4H,5,8H21H |
| InChIKey | DLZXLCHQWOZGSE-UHFFFAOYSA-N |
| SMILES | Cl.NCc1cccc(c1)[N+]([O-])=O |
화학적 성질
white to light yellow crystal powde
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 2811 |
| 관세 코드 | 29420000 |
| 위험 문구(R) | 36/37/38-33-23/24 |
| 위험 표시 | Xi,T |
| 안전 문구(S) | 26-36-24/25 |
| 포장분류 | III |
| 위험 등급 | 6.1(b)Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3-Nitrobenzylamine Hydrochloride is an intermediate in many organic syntheses.